The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(5-(4-Benzylpiperazin-1-yl)pentyl)-5-((3,5-dinitrobenzyl)sulfanyl)-1,3,4-oxadiazole ID: ALA4102258
PubChem CID: 137635737
Max Phase: Preclinical
Molecular Formula: C25H30N6O5S
Molecular Weight: 526.62
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=[N+]([O-])c1cc(CSc2nnc(CCCCCN3CCN(Cc4ccccc4)CC3)o2)cc([N+](=O)[O-])c1
Standard InChI: InChI=1S/C25H30N6O5S/c32-30(33)22-15-21(16-23(17-22)31(34)35)19-37-25-27-26-24(36-25)9-5-2-6-10-28-11-13-29(14-12-28)18-20-7-3-1-4-8-20/h1,3-4,7-8,15-17H,2,5-6,9-14,18-19H2
Standard InChI Key: RHPCYLUAGGSGMA-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
29.0611 -19.4277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6465 -20.1346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0514 -20.8450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8706 -20.8497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2834 -20.1380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8761 -19.4305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8293 -20.1295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4163 -20.8347 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
26.5992 -20.8297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1222 -20.1668 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.3435 -20.4145 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.3384 -21.2318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1140 -21.4890 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.6744 -21.7081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9299 -21.3711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2658 -21.8474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2880 -18.7181 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.8811 -18.0094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.1052 -18.7201 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.2788 -21.5597 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.0960 -21.5628 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.8675 -22.2659 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.5213 -21.5105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8573 -21.9868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1128 -21.6498 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0362 -20.8335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2958 -20.4963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6290 -20.9693 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7076 -21.7837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4530 -22.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8858 -20.6296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2199 -21.1034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4787 -20.7589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8132 -21.2319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8903 -22.0464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6384 -22.3855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3007 -21.9104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 9 1 0
12 14 1 0
14 15 1 0
15 16 1 0
17 18 2 0
17 19 1 0
6 17 1 0
20 21 2 0
20 22 1 0
4 20 1 0
16 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
25 30 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
28 31 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
M CHG 4 17 1 19 -1 20 1 22 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 526.62Molecular Weight (Monoisotopic): 526.1998AlogP: 4.71#Rotatable Bonds: 13Polar Surface Area: 131.68Molecular Species: NEUTRALHBA: 10HBD: ┄#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.30CX LogP: 4.77CX LogD: 3.82Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.13Np Likeness Score: -1.75
References 1. Roh J, Karabanovich G, Vlčková H, Carazo A, Němeček J, Sychra P, Valášková L, Pavliš O, Stolaříková J, Klimešová V, Vávrová K, Pávek P, Hrabálek A.. (2017) Development of water-soluble 3,5-dinitrophenyl tetrazole and oxadiazole antitubercular agents., 25 (20): [PMID:28835350 ] [10.1016/j.bmc.2017.08.010 ]