The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3S,4R)-N-3-Hydroxy-N-1-,3-dimethyl-4-[({4-[(2-methylquinolin-4-yl)methoxy]phenyl}sulfonyl)amino]piperidine-1,3-dicarboxamide) ID: ALA4102629
PubChem CID: 57848908
Max Phase: Preclinical
Molecular Formula: C26H31N5O6S
Molecular Weight: 541.63
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)N1CC[C@@H](NS(=O)(=O)c2ccc(OCc3cc(C)nc4ccccc34)cc2)[C@@](C)(C(=O)NO)C1
Standard InChI: InChI=1S/C26H31N5O6S/c1-17-14-18(21-6-4-5-7-22(21)28-17)15-37-19-8-10-20(11-9-19)38(35,36)30-23-12-13-31(25(33)27-3)16-26(23,2)24(32)29-34/h4-11,14,23,30,34H,12-13,15-16H2,1-3H3,(H,27,33)(H,29,32)/t23-,26+/m1/s1
Standard InChI Key: MCKSCWWXOVOQMO-BVAGGSTKSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
9.5582 -8.4665 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9749 -9.1832 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.3872 -8.4640 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.8317 -8.3457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8306 -9.1730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5453 -9.5859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5436 -7.9329 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2590 -8.3420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2597 -9.1689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9750 -9.5798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6900 -9.1651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6853 -8.3351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9694 -7.9279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1171 -7.9334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5472 -10.4109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8338 -10.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1183 -10.4142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1211 -9.5899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4065 -9.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6921 -9.5934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6966 -10.4226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4118 -10.8297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2632 -9.5986 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2661 -10.4236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5520 -10.8323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5530 -11.6537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2672 -12.0675 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9819 -11.6535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9827 -10.8259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8381 -10.4190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8391 -9.5940 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1231 -10.8306 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4092 -10.4172 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9624 -11.4124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2671 -12.8925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5525 -13.3049 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9815 -13.3051 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8382 -12.8923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
4 14 1 0
6 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
20 2 1 0
2 23 1 0
24 23 1 6
24 25 1 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
25 30 1 6
30 31 2 0
30 32 1 0
32 33 1 0
25 34 1 0
27 35 1 0
35 36 1 0
35 37 2 0
36 38 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 541.63Molecular Weight (Monoisotopic): 541.1995AlogP: 2.33#Rotatable Bonds: 7Polar Surface Area: 149.96Molecular Species: NEUTRALHBA: 7HBD: 4#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.80CX Basic pKa: 5.02CX LogP: 1.16CX LogD: 1.14Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.26Np Likeness Score: -0.95
References 1. Ouvry G, Berton Y, Bhurruth-Alcor Y, Bonnary L, Bouix-Peter C, Bouquet K, Bourotte M, Chambon S, Comino C, Deprez B, Duvert D, Duvert G, Hacini-Rachinel F, Harris CS, Luzy AP, Mathieu A, Millois C, Pascau J, Pinto A, Polge G, Reitz A, Reversé K, Rosignoli C, Taquet N, Hennequin LF.. (2017) Identification of novel TACE inhibitors compatible with topical application., 27 (8): [PMID:28274635 ] [10.1016/j.bmcl.2017.02.035 ]