The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-hydroxy-4-((Z)-7-((1R,2R,3R)-3-hydroxy-2-((S,E)-3-hydroxyoct-1-enyl)-5-oxocyclopentyl)hept-5-enamido)butane-1,1-diyldiphosphonic acid ID: ALA4102742
PubChem CID: 9808443
Max Phase: Preclinical
Molecular Formula: C24H43NO11P2
Molecular Weight: 583.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCC[C@H](O)/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1C/C=C\CCCC(=O)NCCCC(O)(P(=O)(O)O)P(=O)(O)O
Standard InChI: InChI=1S/C24H43NO11P2/c1-2-3-6-10-18(26)13-14-20-19(21(27)17-22(20)28)11-7-4-5-8-12-23(29)25-16-9-15-24(30,37(31,32)33)38(34,35)36/h4,7,13-14,18-20,22,26,28,30H,2-3,5-6,8-12,15-17H2,1H3,(H,25,29)(H2,31,32,33)(H2,34,35,36)/b7-4-,14-13+/t18-,19+,20+,22+/m0/s1
Standard InChI Key: VLSZLSIEZWDASB-DMKBRLEBSA-N
Molfile:
RDKit 2D
38 38 0 0 0 0 0 0 0 0999 V2000
34.9287 -26.4720 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.3415 -25.7663 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
34.5239 -25.7617 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.0761 -23.9255 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.2907 -24.7180 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
36.8697 -24.1359 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.5752 -25.3165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3924 -25.3165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6468 -24.5397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9838 -24.0576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3250 -24.5397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4243 -24.2883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5953 -23.4892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3729 -23.2378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9794 -23.7854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7569 -23.5340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3635 -24.0816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1410 -23.8302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7475 -24.3778 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.3120 -23.0311 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.8719 -25.9781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6848 -25.8937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1643 -26.5553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9771 -26.4709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8311 -27.3015 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.4567 -27.1325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2695 -27.0481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7491 -27.7098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5619 -27.6253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0940 -25.9770 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.9825 -23.2404 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.5251 -24.1264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1316 -24.6740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9092 -24.4226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5157 -24.9702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0926 -25.5475 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.9512 -26.3170 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.8998 -25.2664 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 1 0
6 5 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 7 1 0
9 12 1 6
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
8 21 1 1
21 22 2 0
22 23 1 0
23 24 1 0
23 25 1 6
24 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
7 30 1 6
10 31 2 0
19 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 5 1 0
35 2 1 0
35 36 1 0
2 37 2 0
5 38 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 583.55Molecular Weight (Monoisotopic): 583.2311AlogP: 2.06#Rotatable Bonds: 18Polar Surface Area: 221.92Molecular Species: ACIDHBA: 7HBD: 8#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 8#RO5 Violations (Lipinski): 3CX Acidic pKa: 0.69CX Basic pKa: ┄CX LogP: 0.43CX LogD: -4.50Aromatic Rings: ┄Heavy Atoms: 38QED Weighted: 0.07Np Likeness Score: 1.19
References 1. Xie H, Chen G, Young RN.. (2017) Design, Synthesis, and Pharmacokinetics of a Bone-Targeting Dual-Action Prodrug for the Treatment of Osteoporosis., 60 (16): [PMID:28699744 ] [10.1021/acs.jmedchem.6b00951 ]