4-((((6-Bromoquinolin-2-yl)methyl)amino)methyl)-N-hydroxybenzamide

ID: ALA4103018

PubChem CID: 137658490

Max Phase: Preclinical

Molecular Formula: C18H16BrN3O2

Molecular Weight: 386.25

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(NO)c1ccc(CNCc2ccc3cc(Br)ccc3n2)cc1

Standard InChI:  InChI=1S/C18H16BrN3O2/c19-15-6-8-17-14(9-15)5-7-16(21-17)11-20-10-12-1-3-13(4-2-12)18(23)22-24/h1-9,20,24H,10-11H2,(H,22,23)

Standard InChI Key:  OZPBCINWVGTSDK-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
   11.3113   -1.6385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3102   -2.4580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0182   -2.8670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0164   -1.2296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7250   -1.6349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7258   -2.4539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4343   -2.8610    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.1426   -2.4501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1379   -1.6280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4288   -1.2246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8519   -2.8560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5580   -2.4446    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.2673   -2.8505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9734   -2.4391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6776   -2.8478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3833   -2.4372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3805   -1.6191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6663   -1.2134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9635   -1.6264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0861   -1.2068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7959   -1.6117    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.0818   -0.3896    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.8002   -2.4289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6035   -1.2300    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  8 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 17 20  1  0
 20 21  1  0
 20 22  2  0
 21 23  1  0
  1 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4103018

    ---

Associated Targets(Human)

HDAC1 Tclin Histone deacetylase (HDAC1 and HDAC2) (618 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 386.25Molecular Weight (Monoisotopic): 385.0426AlogP: 3.41#Rotatable Bonds: 5
Polar Surface Area: 74.25Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 9.07CX Basic pKa: 7.67CX LogP: 2.90CX LogD: 2.63
Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.46Np Likeness Score: -1.19

References

1. Chen C, Hou X, Wang G, Pan W, Yang X, Zhang Y, Fang H..  (2017)  Design, synthesis and biological evaluation of quinoline derivatives as HDAC class I inhibitors.,  133  [PMID:28371677] [10.1016/j.ejmech.2017.03.064]

Source