The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-Methoxyphenyl)-2-(2-(4-methoxyphenyl)-2-oxoethyl)-9H-pyrido[3,4-b]indol-2-ium bromide ID: ALA4103124
PubChem CID: 137656882
Max Phase: Preclinical
Molecular Formula: C27H23BrN2O3
Molecular Weight: 423.49
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C(=O)C[n+]2ccc3c([nH]c4ccccc43)c2-c2ccc(OC)cc2)cc1.[Br-]
Standard InChI: InChI=1S/C27H22N2O3.BrH/c1-31-20-11-7-18(8-12-20)25(30)17-29-16-15-23-22-5-3-4-6-24(22)28-26(23)27(29)19-9-13-21(32-2)14-10-19;/h3-16H,17H2,1-2H3;1H
Standard InChI Key: OMUMYPIRJJDGSK-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
19.6821 -8.5741 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
15.3503 -6.8661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0690 -7.6441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6016 -8.2748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1599 -6.7190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6944 -7.3462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4174 -8.1297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0769 -8.6353 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.5251 -7.3676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7598 -8.1627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5641 -8.3556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1345 -7.7545 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.8951 -6.9574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0913 -6.7682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9370 -7.9455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5037 -7.3459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3063 -7.5369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2679 -6.5553 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.5363 -8.3265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3380 -8.5177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9057 -7.9178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6661 -7.1239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8649 -6.9364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7990 -9.1458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2294 -9.7442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4632 -10.5345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2662 -10.7276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8351 -10.1241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5982 -9.3361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5017 -11.5183 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.9347 -12.1175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7085 -8.1078 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.9454 -8.8980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 7 2 0
6 5 2 0
5 2 1 0
6 7 1 0
7 8 1 0
8 10 1 0
9 6 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
12 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
17 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 17 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
11 24 1 0
27 30 1 0
30 31 1 0
21 32 1 0
32 33 1 0
M CHG 2 1 -1 12 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 423.49Molecular Weight (Monoisotopic): 423.1703AlogP: 5.18#Rotatable Bonds: 6Polar Surface Area: 55.20Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.39CX Basic pKa: ┄CX LogP: 0.41CX LogD: 0.41Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.30Np Likeness Score: 0.04
References 1. Venkataramana Reddy PO, Mishra S, Tantak MP, Nikhil K, Sadana R, Shah K, Kumar D.. (2017) Design, synthesis and in vitro cytotoxicity studies of novel β-carbolinium bromides., 27 (6): [PMID:28254167 ] [10.1016/j.bmcl.2017.02.010 ]