(S)-2-(((1r,4S)-4-(4-Amino-5-(4-phenoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidin-7-yl)cyclohexyl)amino)-N,N,4-trimethylpentanamide

ID: ALA4103186

PubChem CID: 131632972

Max Phase: Preclinical

Molecular Formula: C32H40N6O2

Molecular Weight: 540.71

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)C[C@H](N[C@H]1CC[C@H](n2cc(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)CC1)C(=O)N(C)C

Standard InChI:  InChI=1S/C32H40N6O2/c1-21(2)18-28(32(39)37(3)4)36-23-12-14-24(15-13-23)38-19-27(29-30(33)34-20-35-31(29)38)22-10-16-26(17-11-22)40-25-8-6-5-7-9-25/h5-11,16-17,19-21,23-24,28,36H,12-15,18H2,1-4H3,(H2,33,34,35)/t23-,24-,28-/m0/s1

Standard InChI Key:  KOBNNQXCSZBAFN-QONNDPFASA-N

Molfile:  

     RDKit          2D

 40 44  0  0  0  0  0  0  0  0999 V2000
    1.7111  -17.7247    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7099  -18.5520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4247  -18.9649    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4229  -17.3119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1383  -17.7211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1431  -18.5521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9350  -18.8043    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4196  -18.1290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9271  -17.4597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1774  -16.6736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9826  -16.5029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2331  -15.7176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6771  -15.1069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8675  -15.2867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6209  -16.0717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1923  -19.5851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6417  -20.2008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8982  -20.9812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7057  -21.1522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2562  -20.5365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9993  -19.7497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9614  -21.9307    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9264  -14.3204    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7321  -14.1431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2869  -14.7528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0920  -14.5760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3420  -13.7889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7807  -13.1784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9777  -13.3584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4204  -16.4869    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.7689  -22.0996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0263  -22.8834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3189  -21.4848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1264  -21.6537    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0615  -20.7010    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4764  -23.4983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7338  -24.2821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6688  -23.3294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6764  -21.0388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3839  -22.4374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
 16 17  1  0
 16 21  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 16  7  1  1
 19 22  1  6
 13 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
  4 30  1  0
 22 31  1  0
 31 32  1  6
 31 33  1  0
 33 34  1  0
 33 35  2  0
 32 36  1  0
 36 37  1  0
 36 38  1  0
 34 39  1  0
 34 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4103186

    ---

Associated Targets(Human)

HCK Tclin Tyrosine-protein kinase HCK (2743 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 540.71Molecular Weight (Monoisotopic): 540.3213AlogP: 6.05#Rotatable Bonds: 9
Polar Surface Area: 98.30Molecular Species: BASEHBA: 7HBD: 2
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 9.59CX LogP: 5.33CX LogD: 3.15
Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.27Np Likeness Score: -0.58

References

1. Yuki H, Kikuzato K, Koda Y, Mikuni J, Tomabechi Y, Kukimoto-Niino M, Tanaka A, Shirai F, Shirouzu M, Koyama H, Honma T..  (2017)  Activity cliff for 7-substituted pyrrolo-pyrimidine inhibitors of HCK explained in terms of predicted basicity of the amine nitrogen.,  25  (16): [PMID:28662963] [10.1016/j.bmc.2017.05.053]

Source