(2R,3R,4R,5R)-2-(acetoxymethyl)-5-(4-((N-p-tolylphenylsulfonamido)methyl)-1H-1,2,3-triazol-1-yl)tetrahydrofuran-3,4-diyl diacetate

ID: ALA4103273

PubChem CID: 137656439

Max Phase: Preclinical

Molecular Formula: C27H30N4O9S

Molecular Weight: 586.62

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)OC[C@H]1O[C@@H](n2cc(CN(c3ccc(C)cc3)S(=O)(=O)c3ccccc3)nn2)[C@H](OC(C)=O)[C@@H]1OC(C)=O

Standard InChI:  InChI=1S/C27H30N4O9S/c1-17-10-12-22(13-11-17)31(41(35,36)23-8-6-5-7-9-23)15-21-14-30(29-28-21)27-26(39-20(4)34)25(38-19(3)33)24(40-27)16-37-18(2)32/h5-14,24-27H,15-16H2,1-4H3/t24-,25-,26-,27-/m1/s1

Standard InChI Key:  MHLCDZHRMMBKNK-FPCALVHFSA-N

Molfile:  

     RDKit          2D

 41 44  0  0  0  0  0  0  0  0999 V2000
   15.9542   -8.3750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5458   -9.0916    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   16.3706   -9.0870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1625  -10.1709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9875  -10.1709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2442   -9.3867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5750   -8.9000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9099   -9.3867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0292   -9.1328    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.4716  -10.8389    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6767  -10.8377    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1252   -9.1321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5124   -9.6844    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7276   -9.4298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1147   -9.9822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5557   -8.6230    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0112  -11.5918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5254  -12.2586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8316  -11.6790    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.2921  -10.7536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7763  -11.4216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6286  -10.0003    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.6983   -9.6153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3664   -9.1313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1125   -8.3463    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2876   -8.3453    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.1507   -9.3873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7645   -8.8362    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.5941   -8.0290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7192   -9.8994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2093   -7.4836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0394   -6.6771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2545   -6.4204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6392   -6.9764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8123   -7.7808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1046  -10.4478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2775  -11.2549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0644  -11.5093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6787  -10.9504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5027  -10.1454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0830   -5.6134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  4  1  0
  6  9  1  1
  5 10  1  6
  4 11  1  6
  8 12  1  1
 12 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 11 17  1  0
 17 18  1  0
 17 19  2  0
 10 20  1  0
 20 21  1  0
 20 22  2  0
  9 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26  9  1  0
 24 27  1  0
 27 28  1  0
 28  2  1  0
 28 29  1  0
  2 30  1  0
 29 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 29  1  0
 30 36  2  0
 36 37  1  0
 37 38  2  0
 38 39  1  0
 39 40  2  0
 40 30  1  0
 33 41  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4103273

    ---

Associated Targets(Human)

RCC4 (73 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MDA-MB-231 (73002 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 586.62Molecular Weight (Monoisotopic): 586.1733AlogP: 2.31#Rotatable Bonds: 10
Polar Surface Area: 156.22Molecular Species: NEUTRALHBA: 12HBD:
#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 2.59CX LogD: 2.59
Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.25Np Likeness Score: -0.52

References

1. Alaoui S, Dufies M, Driowya M, Demange L, Bougrin K, Robert G, Auberger P, Pagès G, Benhida R..  (2017)  Synthesis and anti-cancer activities of new sulfonamides 4-substituted-triazolyl nucleosides.,  27  (9): [PMID:28325600] [10.1016/j.bmcl.2017.03.018]

Source