The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-desmethyl Englerin A ID: ALA4103330
PubChem CID: 137657858
Max Phase: Preclinical
Molecular Formula: C25H32O6
Molecular Weight: 428.53
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)[C@]12C[C@@H](OC(=O)CO)[C@](C)(O1)[C@@H]1CCC[C@H]1[C@@H]2OC(=O)/C=C/c1ccccc1
Standard InChI: InChI=1S/C25H32O6/c1-16(2)25-14-20(29-22(28)15-26)24(3,31-25)19-11-7-10-18(19)23(25)30-21(27)13-12-17-8-5-4-6-9-17/h4-6,8-9,12-13,16,18-20,23,26H,7,10-11,14-15H2,1-3H3/b13-12+/t18-,19-,20-,23+,24-,25+/m1/s1
Standard InChI Key: NPVSBJCCCCHRKG-FDPHBAIQSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
10.0811 -7.9318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8226 -8.2980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0008 -9.1022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6526 -9.7335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4786 -9.7394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1437 -9.0824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3331 -8.2802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6287 -7.8523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0040 -8.3898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3223 -9.1500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5423 -7.4797 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.7256 -9.7923 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10.0590 -9.0131 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2663 -10.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8289 -10.4864 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6511 -10.5564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0014 -11.3034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1227 -9.8795 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5296 -11.9803 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4452 -7.7567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2253 -8.0253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2878 -6.9468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0905 -7.1067 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3807 -6.6861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3901 -5.8611 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5547 -6.6838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1442 -5.9680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3191 -5.9657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9137 -5.2492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0895 -5.2465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6741 -5.9604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0891 -6.6785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9120 -6.6777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7 1 1 0
1 2 1 0
2 3 1 0
6 4 1 0
3 5 1 0
4 5 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 6 1 0
7 11 1 6
6 12 1 1
4 13 1 0
13 2 1 0
4 14 1 6
5 15 1 1
15 16 1 0
16 17 1 0
16 18 2 0
17 19 1 0
2 20 1 6
20 21 1 0
20 22 1 0
1 23 1 6
23 24 1 0
24 25 2 0
24 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 428.53Molecular Weight (Monoisotopic): 428.2199AlogP: 3.52#Rotatable Bonds: 6Polar Surface Area: 82.06Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.13CX Basic pKa: ┄CX LogP: 4.09CX LogD: 4.09Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.55Np Likeness Score: 2.15