The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(1-{[4-(Dimethylsulfamoyl)phenyl]methyl}-2,4-dioxo-1,2,3,4-tetrahydropyrimidin-5-yl)-N-[(4-fluoro-3-methoxyphenyl)methyl]prop-2-ynamide ID: ALA4103533
PubChem CID: 137656900
Max Phase: Preclinical
Molecular Formula: C24H23FN4O6S
Molecular Weight: 514.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(CNC(=O)C#Cc2cn(Cc3ccc(S(=O)(=O)N(C)C)cc3)c(=O)[nH]c2=O)ccc1F
Standard InChI: InChI=1S/C24H23FN4O6S/c1-28(2)36(33,34)19-8-4-16(5-9-19)14-29-15-18(23(31)27-24(29)32)7-11-22(30)26-13-17-6-10-20(25)21(12-17)35-3/h4-6,8-10,12,15H,13-14H2,1-3H3,(H,26,30)(H,27,31,32)
Standard InChI Key: AIEFEBZFXCTALP-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 38 0 0 0 0 0 0 0 0999 V2000
16.6988 -6.6118 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1115 -7.3217 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
17.5199 -6.6093 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.6496 -7.7191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6496 -8.5424 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.3617 -8.9468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0634 -8.5424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0634 -7.7191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3617 -7.3043 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.7741 -8.9504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4846 -9.3665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9361 -7.3096 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.7768 -7.3096 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.1986 -9.7760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1951 -10.5952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.9079 -9.3684 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.6219 -9.7779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3353 -9.3745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0407 -9.7888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7492 -9.3823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7565 -8.5626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0421 -8.1480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3339 -8.5581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0444 -7.3309 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.9458 -8.9518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2346 -8.5441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2358 -7.7312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5300 -7.3236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8207 -7.7330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8239 -8.5565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5347 -8.9585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7532 -6.9242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4665 -8.1580 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.4053 -7.7357 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.4107 -8.5529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6948 -7.3319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
4 9 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 1 0
7 10 1 0
10 11 3 0
4 12 2 0
8 13 2 0
11 14 1 0
14 15 2 0
14 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
22 24 1 0
5 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
24 32 1 0
21 33 1 0
29 2 1 0
2 34 1 0
34 35 1 0
34 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 514.54Molecular Weight (Monoisotopic): 514.1322AlogP: 0.65#Rotatable Bonds: 7Polar Surface Area: 130.57Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.49CX Basic pKa: ┄CX LogP: 1.33CX LogD: 1.33Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.45Np Likeness Score: -1.43
References 1. Senn N, Ott M, Lanz J, Riedl R.. (2017) Targeted Polypharmacology: Discovery of a Highly Potent Non-Hydroxamate Dual Matrix Metalloproteinase (MMP)-10/-13 Inhibitor., 60 (23): [PMID:28953404 ] [10.1021/acs.jmedchem.7b01001 ]