Diethyl {5-[(3-(3-fluorobenzyl)-2,4-dioxo-3,4-dihydroquinazolin-1(2H)-yl)methyl]-2-methylisoxazolidin-3-yl}phosphonate

ID: ALA4103554

PubChem CID: 137657318

Max Phase: Preclinical

Molecular Formula: C24H29FN3O6P

Molecular Weight: 505.48

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CCOP(=O)(OCC)C1CC(Cn2c(=O)n(Cc3cccc(F)c3)c(=O)c3ccccc32)ON1C

Standard InChI:  InChI=1S/C24H29FN3O6P/c1-4-32-35(31,33-5-2)22-14-19(34-26(22)3)16-27-21-12-7-6-11-20(21)23(29)28(24(27)30)15-17-9-8-10-18(25)13-17/h6-13,19,22H,4-5,14-16H2,1-3H3

Standard InChI Key:  GLLIJKZBLPWGIT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
    8.5752   -8.2847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1186   -7.0669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8728   -7.0566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8738   -5.4201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4455   -9.8894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2856   -5.4136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2711   -8.5612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8312   -6.6564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5803   -5.8280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6837   -9.2716    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.7033   -7.0606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1575   -9.0521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7051   -5.4199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1602   -5.8261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1220   -5.4245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4102   -6.6523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5452   -5.4224    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.3481  -10.0212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6725   -9.7154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5776   -6.6471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9935   -5.8262    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1232   -7.7254    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2856   -7.0555    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.8309   -5.8312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9935   -6.6471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4865   -9.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9739   -9.1383    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8608   -9.1806    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8552  -10.6014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4547   -8.4750    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    7.1617   -6.6482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4143   -5.8303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8232   -7.9522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2856   -7.8764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2842   -4.5927    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 33  7  1  0
 20  9  2  0
 21  6  1  0
  8 24  1  0
  7 10  1  0
 24 15  2  0
 15 32  1  0
  9  4  1  0
 28  5  1  0
  6 35  2  0
 27 12  1  0
 23 25  1  0
  9  6  1  0
 14 31  1  0
  1 34  1  0
 30 27  1  0
 23 34  1  0
 20 23  1  0
 25 11  2  0
  1 33  1  0
 13 32  1  0
 30 22  2  0
 24 17  1  0
  4 14  2  0
 10 26  1  0
 10 18  1  0
 32 16  2  0
  3 20  1  0
 12 19  1  0
 30 28  1  0
 21 13  1  0
 31  3  2  0
 16  2  1  0
  7 30  1  0
  5 29  1  0
  2  8  2  0
 25 21  1  0
 26  1  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4103554

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 505.48

Molecular Weight (Monoisotopic): 505.1778

AlogP: 3.58

#Rotatable Bonds: 9

Polar Surface Area: 92.00

Molecular Species: NEUTRAL

HBA: 9

HBD: ┄

#RO5 Violations: 1

HBA (Lipinski): 9

HBD (Lipinski): ┄

#RO5 Violations (Lipinski): 1

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: 3.26

CX LogD: 3.26

Aromatic Rings: 3

Heavy Atoms: 35

QED Weighted: 0.41

Np Likeness Score: -0.95

References

1. Piotrowska DG, Andrei G, Schols D, Snoeck R, Łysakowska M..  (2017)  Synthesis, anti-varicella-zoster virus and anti-cytomegalovirus activity of quinazoline-2,4-diones containing isoxazolidine and phosphonate substructures.,  126  [PMID:27750154] [10.1016/j.ejmech.2016.10.002]

Source

Source(1):

• Scientific Literature