The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-Carbamimidoyl-2-{3-[2-(morpholin-4-yl)pyrimidin-5-yl]phenyl}acetamide (2R,3R)-tartrate ID: ALA4103619
PubChem CID: 146029979
Max Phase: Preclinical
Molecular Formula: C21H26N6O8
Molecular Weight: 340.39
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: N=C(N)NC(=O)Cc1cccc(-c2cnc(N3CCOCC3)nc2)c1.O=C(O)[C@H](O)[C@@H](O)C(=O)O
Standard InChI: InChI=1S/C17H20N6O2.C4H6O6/c18-16(19)22-15(24)9-12-2-1-3-13(8-12)14-10-20-17(21-11-14)23-4-6-25-7-5-23;5-1(3(7)8)2(6)4(9)10/h1-3,8,10-11H,4-7,9H2,(H4,18,19,22,24);1-2,5-6H,(H,7,8)(H,9,10)/t;1-,2-/m.1/s1
Standard InChI Key: GNMWSWRBHZFPRI-LREBCSMRSA-N
Molfile:
RDKit 2D
35 36 0 0 0 0 0 0 0 0999 V2000
9.8405 -11.0764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5496 -9.8465 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2587 -11.8978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5496 -10.6679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2587 -11.0764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9719 -10.6679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8405 -11.8978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1273 -10.6679 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9719 -9.8465 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6810 -11.0764 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5685 -7.9495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8554 -8.3522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2693 -8.3681 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5807 -7.1324 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1546 -7.9336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4416 -8.3321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7366 -7.9135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7489 -7.0964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4619 -6.6979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1627 -7.1165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5975 -9.1090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6097 -8.2919 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3228 -7.8934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0236 -8.3120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0155 -9.1291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3024 -9.5276 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8844 -9.5116 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8763 -10.3287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1633 -10.7272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4583 -10.3087 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4706 -9.4916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1836 -9.0931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2938 -6.7339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3019 -5.9169 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9946 -7.1525 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 4 1 0
4 2 1 6
4 5 1 0
5 3 1 6
5 6 1 0
1 7 2 0
1 8 1 0
6 9 2 0
6 10 1 0
11 12 1 0
11 13 2 0
11 14 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
15 20 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
21 26 2 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
27 32 1 0
21 27 1 0
17 24 1 0
12 15 1 0
33 34 1 0
33 35 2 0
14 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 340.39Molecular Weight (Monoisotopic): 340.1648AlogP: 0.53#Rotatable Bonds: 4Polar Surface Area: 117.22Molecular Species: BASEHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.44CX Basic pKa: 8.80CX LogP: 0.82CX LogD: -0.56Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.55Np Likeness Score: -1.33
References 1. Yamaki S, Yamada H, Nagashima A, Kondo M, Shimada Y, Kadono K, Yoshihara K.. (2017) Synthesis and structure activity relationships of carbamimidoylcarbamate derivatives as novel vascular adhesion protein-1 inhibitors., 25 (21): [PMID:28988626 ] [10.1016/j.bmc.2017.09.036 ]