The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-(4-(1,3-dioxo-hexahydro-1H-isoindol-2(3H)-yl)phenylsulfonyl)phenyl)-hexahydro-2H-isoindole-1,3-dione ID: ALA4103728
PubChem CID: 137657472
Max Phase: Preclinical
Molecular Formula: C28H28N2O6S
Molecular Weight: 520.61
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C1C2CCCCC2C(=O)N1c1ccc(S(=O)(=O)c2ccc(N3C(=O)C4CCCCC4C3=O)cc2)cc1
Standard InChI: InChI=1S/C28H28N2O6S/c31-25-21-5-1-2-6-22(21)26(32)29(25)17-9-13-19(14-10-17)37(35,36)20-15-11-18(12-16-20)30-27(33)23-7-3-4-8-24(23)28(30)34/h9-16,21-24H,1-8H2
Standard InChI Key: RUHUTNVUPFBDFE-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 42 0 0 0 0 0 0 0 0999 V2000
19.6828 -1.1969 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.0955 -1.9068 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.5039 -1.1944 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.6721 -3.5262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3818 -3.1248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3881 -2.3113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6853 -1.8982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9748 -2.3046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9720 -3.1168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8034 -2.3222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7940 -3.1384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4977 -3.5524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2095 -3.1492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2132 -2.3278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5089 -1.9175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9146 -3.5623 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2625 -3.5222 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5210 -3.1852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1770 -4.3332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9908 -4.3757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6591 -3.2349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3770 -4.4997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9731 -3.7856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1572 -3.7784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7392 -4.4835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1430 -5.1976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9650 -5.2065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2022 -3.8455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7845 -4.5501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1837 -5.2602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0020 -5.2718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4197 -4.5672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0190 -3.8510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7830 -4.8814 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3569 -2.3847 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.3785 -4.9169 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.8334 -2.4364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
6 2 1 0
2 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
13 16 1 0
9 17 1 0
17 18 1 0
18 23 1 0
22 19 1 0
19 17 1 0
16 20 1 0
20 29 1 0
28 21 1 0
21 16 1 0
22 23 1 0
22 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
28 29 1 0
28 33 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
19 34 2 0
18 35 2 0
20 36 2 0
21 37 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 520.61Molecular Weight (Monoisotopic): 520.1668AlogP: 3.88#Rotatable Bonds: 4Polar Surface Area: 108.90Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.78CX LogD: 3.78Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.57Np Likeness Score: -0.61
References 1. Kumar A, Banerjee S, Roy P, Sondhi SM, Sharma A.. (2017) Solvent free, catalyst free, microwave or grinding assisted synthesis of bis-cyclic imide derivatives and their evaluation for anticancer activity., 27 (3): [PMID:28011220 ] [10.1016/j.bmcl.2016.12.031 ]