N-(((2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)pyrrolidin-2-yl)methyl)-2-(3-(trifluoromethyl)phenyl)acetamide

ID: ALA4103918

PubChem CID: 137657627

Max Phase: Preclinical

Molecular Formula: C15H19F3N2O4

Molecular Weight: 348.32

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Cc1cccc(C(F)(F)F)c1)NC[C@@H]1N[C@H](CO)[C@H](O)[C@@H]1O

Standard InChI:  InChI=1S/C15H19F3N2O4/c16-15(17,18)9-3-1-2-8(4-9)5-12(22)19-6-10-13(23)14(24)11(7-21)20-10/h1-4,10-11,13-14,20-21,23-24H,5-7H2,(H,19,22)/t10-,11+,13+,14-/m0/s1

Standard InChI Key:  YHIPMONRWUIBGM-UNJBNNCHSA-N

Molfile:  

     RDKit          2D

 24 25  0  0  0  0  0  0  0  0999 V2000
   23.6738   -3.7682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4909   -3.7682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7453   -2.9915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0823   -2.5094    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.4236   -2.9915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6463   -2.7393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4760   -1.9400    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.1926   -4.4287    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.9705   -4.4299    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.5229   -2.7400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6939   -1.9409    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.4714   -1.6895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6424   -0.8904    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.0779   -2.2371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9069   -3.0362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1296   -3.2831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9584   -4.0814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5653   -4.6299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3461   -4.3747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5136   -3.5770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9545   -4.9202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7864   -5.7199    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   28.7312   -4.6660    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   28.5315   -5.4975    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  5  6  1  1
  6  7  1  0
  1  8  1  1
  2  9  1  1
  3 10  1  1
 10 11  1  0
 11 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 19 21  1  0
 21 22  1  0
 21 23  1  0
 21 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4103918

    ---

Associated Targets(Human)

GLA Tclin Alpha-galactosidase A (5444 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 348.32Molecular Weight (Monoisotopic): 348.1297AlogP: -0.58#Rotatable Bonds: 5
Polar Surface Area: 101.82Molecular Species: BASEHBA: 5HBD: 5
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 13.19CX Basic pKa: 8.67CX LogP: -0.46CX LogD: -1.75
Aromatic Rings: 1Heavy Atoms: 24QED Weighted: 0.49Np Likeness Score: -0.18

References

1. Cheng WC, Wang JH, Yun WY, Li HY, Hu JM..  (2017)  Rapid preparation of (3R,4S,5R) polyhydroxylated pyrrolidine-based libraries to discover a pharmacological chaperone for treatment of Fabry disease.,  126  [PMID:27744182] [10.1016/j.ejmech.2016.10.004]

Source