(2S,4R)-4-(4-((E)-3-(2-aminophenylamino)-3-oxoprop-1-enyl)-1H-1,2,3-triazol-1-yl)-1-(3-phenylpropyl)pyrrolidine-2-carboxylic acid

ID: ALA4103969

PubChem CID: 137656777

Max Phase: Preclinical

Molecular Formula: C25H28N6O3

Molecular Weight: 460.54

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Nc1ccccc1NC(=O)/C=C/c1cn([C@@H]2C[C@@H](C(=O)O)N(CCCc3ccccc3)C2)nn1

Standard InChI:  InChI=1S/C25H28N6O3/c26-21-10-4-5-11-22(21)27-24(32)13-12-19-16-31(29-28-19)20-15-23(25(33)34)30(17-20)14-6-9-18-7-2-1-3-8-18/h1-5,7-8,10-13,16,20,23H,6,9,14-15,17,26H2,(H,27,32)(H,33,34)/b13-12+/t20-,23+/m1/s1

Standard InChI Key:  PPETWBUGLLZQBC-GPZLUXPBSA-N

Molfile:  

     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   14.9348  -18.2314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9331  -19.0521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6427  -19.4654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3589  -19.0514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3546  -18.2259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6441  -17.8224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6424  -20.2826    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.0689  -19.4624    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.7770  -19.0521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4871  -19.4591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7751  -18.2308    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.1993  -19.0488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9094  -19.4598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9889  -20.2720    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.7918  -20.4409    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.2029  -19.7307    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.6535  -19.1216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0130  -19.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5665  -20.2509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3130  -19.9146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2269  -19.1002    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.4239  -18.9316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8319  -18.5508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6139  -18.8034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2231  -18.2540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0051  -18.5025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1722  -19.3065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9488  -19.5552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5594  -19.0054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3854  -18.2020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6050  -17.9549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0231  -20.3256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0251  -21.1428    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.7311  -19.9111    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  3  7  1  0
  4  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
 10 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 13  2  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 18  1  0
 18 16  1  1
 21 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 20 32  1  6
 32 33  1  0
 32 34  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4103969

    ---

Associated Targets(Human)

HDAC11 Tclin Histone deacetylase 11 (967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 460.54Molecular Weight (Monoisotopic): 460.2223AlogP: 2.85#Rotatable Bonds: 9
Polar Surface Area: 126.37Molecular Species: ZWITTERIONHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 1.43CX Basic pKa: 9.86CX LogP: 0.41CX LogD: 0.40
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.33Np Likeness Score: -0.96

References

1. Tian Y, Lv W, Li X, Wang C, Wang D, Wang PG, Jin J, Shen J..  (2017)  Stabilizing HDAC11 with SAHA to assay slow-binding benzamide inhibitors.,  27  (13): [PMID:28501514] [10.1016/j.bmcl.2017.05.004]

Source