The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-5-((6-methoxy-1-oxoisoindolin-2-yl)methyl)-5-(4-(trifluoromethyl)furo[3,2-c]pyridin-2-yl)imidazolidine-2,4-dione ID: ALA4104084
PubChem CID: 70232814
Max Phase: Preclinical
Molecular Formula: C21H15F3N4O5
Molecular Weight: 460.37
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2c(c1)C(=O)N(C[C@@]1(c3cc4c(C(F)(F)F)nccc4o3)NC(=O)NC1=O)C2
Standard InChI: InChI=1S/C21H15F3N4O5/c1-32-11-3-2-10-8-28(17(29)12(10)6-11)9-20(18(30)26-19(31)27-20)15-7-13-14(33-15)4-5-25-16(13)21(22,23)24/h2-7H,8-9H2,1H3,(H2,26,27,30,31)/t20-/m0/s1
Standard InChI Key: CHCOFDMLMLXFJJ-FQEVSTJZSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
8.8075 -14.2802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4030 -14.9901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2200 -14.9854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3341 -15.7702 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1512 -15.7702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7426 -14.5113 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0839 -14.9935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6327 -15.6908 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3095 -16.4367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4507 -15.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9929 -15.1577 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6253 -16.5674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9217 -16.9783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9267 -17.7912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6346 -18.1942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3389 -17.7784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3304 -16.9668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0507 -18.1798 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0590 -18.9969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6322 -16.4308 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3066 -14.7413 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6190 -14.1857 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4704 -13.5313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0689 -12.9791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7813 -13.3852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4872 -12.9714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4818 -12.1515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7647 -11.7473 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0617 -12.1635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3500 -11.7619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3420 -10.9447 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.6464 -12.1774 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.6395 -11.3499 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 1
3 2 1 0
4 5 1 0
5 2 1 0
2 6 1 0
6 7 1 0
7 4 1 0
3 8 1 0
8 9 1 0
9 13 1 0
12 10 1 0
10 8 1 0
10 11 2 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
16 18 1 0
18 19 1 0
5 20 2 0
7 21 2 0
1 22 1 0
22 25 1 0
24 23 1 0
23 1 2 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
29 30 1 0
30 31 1 0
30 32 1 0
30 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 460.37Molecular Weight (Monoisotopic): 460.0995AlogP: 2.55#Rotatable Bonds: 4Polar Surface Area: 113.77Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.60CX Basic pKa: 0.34CX LogP: 1.38CX LogD: 1.35Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.58Np Likeness Score: -0.34
References 1. Tong L, Kim SH, Rosner K, Yu W, Shankar BB, Chen L, Li D, Dai C, Girijavallabhan V, Popovici-Muller J, Yang L, Zhou G, Kosinski A, Siddiqui MA, Shih NY, Guo Z, Orth P, Chen S, Lundell D, Niu X, Umland S, Kozlowski JA.. (2017) Fused bi-heteroaryl substituted hydantoin compounds as TACE inhibitors., 27 (14): [PMID:28558971 ] [10.1016/j.bmcl.2017.05.062 ]