The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-(3-((2-(quinolin-4-ylamino)ethyl)amino)propyloxy)-4-((3-phenylpropyl)amino)quinazoline ID: ALA4104103
PubChem CID: 117967641
Max Phase: Preclinical
Molecular Formula: C31H34N6O
Molecular Weight: 506.65
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: c1ccc(CCCNc2ncnc3cc(OCCCNCCNc4ccnc5ccccc45)ccc23)cc1
Standard InChI: InChI=1S/C31H34N6O/c1-2-8-24(9-3-1)10-6-17-35-31-27-14-13-25(22-30(27)36-23-37-31)38-21-7-16-32-19-20-34-29-15-18-33-28-12-5-4-11-26(28)29/h1-5,8-9,11-15,18,22-23,32H,6-7,10,16-17,19-21H2,(H,33,34)(H,35,36,37)
Standard InChI Key: FLTPDIVZQQJCNC-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
11.3331 -12.6526 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.0469 -12.2391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0441 -11.4123 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3313 -11.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6209 -12.2395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6232 -11.4177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9131 -11.0086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2003 -11.4162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2020 -12.2412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9126 -12.6507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3278 -10.1857 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6142 -9.7760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9042 -10.1918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1906 -9.7821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4846 -10.1978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7741 -9.7878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0645 -10.2029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0676 -11.0251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7861 -11.4346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4928 -11.0172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4953 -12.6556 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7825 -12.2445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0716 -12.6589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3588 -12.2520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6479 -12.6623 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9351 -12.2554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2243 -12.6656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5156 -12.2587 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8047 -12.6690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3868 -13.4902 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1046 -13.9010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8121 -13.4850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3853 -12.6680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0945 -12.2610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0936 -11.4446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3842 -11.0343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6743 -11.4504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6787 -12.2654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 5 2 0
4 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
9 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 34 2 0
33 30 2 0
30 31 1 0
31 32 2 0
32 29 1 0
33 34 1 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 506.65Molecular Weight (Monoisotopic): 506.2794AlogP: 5.69#Rotatable Bonds: 14Polar Surface Area: 83.99Molecular Species: BASEHBA: 7HBD: 3#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 9.42CX LogP: 4.92CX LogD: 2.25Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.17Np Likeness Score: -0.95
References 1. Halby L, Menon Y, Rilova E, Pechalrieu D, Masson V, Faux C, Bouhlel MA, David-Cordonnier MH, Novosad N, Aussagues Y, Samson A, Lacroix L, Ausseil F, Fleury L, Guianvarc'h D, Ferroud C, Arimondo PB.. (2017) Rational Design of Bisubstrate-Type Analogues as Inhibitors of DNA Methyltransferases in Cancer Cells., 60 (11): [PMID:28463515 ] [10.1021/acs.jmedchem.7b00176 ]