The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(5,7-Bis(acetamido)-3-acetoxy-2-oxindole-3-yl)acetonitrile ID: ALA4104288
PubChem CID: 137658017
Max Phase: Preclinical
Molecular Formula: C16H16N4O5
Molecular Weight: 344.33
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)Nc1cc(NC(C)=O)c2c(c1)C(CC#N)(OC(C)=O)C(=O)N2
Standard InChI: InChI=1S/C16H16N4O5/c1-8(21)18-11-6-12-14(13(7-11)19-9(2)22)20-15(24)16(12,4-5-17)25-10(3)23/h6-7H,4H2,1-3H3,(H,18,21)(H,19,22)(H,20,24)
Standard InChI Key: RMLLBRMRRXMZFW-UHFFFAOYSA-N
Molfile:
RDKit 2D
25 26 0 0 0 0 0 0 0 0999 V2000
12.9587 -7.9063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5542 -8.6071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3632 -7.2053 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9388 -10.6190 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4149 -9.9640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2132 -10.1047 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9541 -9.3040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1699 -9.5595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4690 -9.1550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7682 -9.5595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7682 -10.3684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4690 -10.7729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1699 -10.3684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7426 -8.6375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.5410 -8.7741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8201 -9.5373 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.0604 -8.1558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7682 -11.9863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0674 -11.5818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7682 -12.7952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4690 -11.5818 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3665 -9.5595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6657 -9.1550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3665 -10.3684 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0674 -9.1550 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 3 0
4 5 1 0
5 6 2 0
5 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
4 13 1 0
8 13 2 0
2 7 1 0
15 16 2 0
15 17 1 0
14 15 1 0
7 14 1 0
18 19 1 0
18 20 2 0
18 21 1 0
12 21 1 0
22 23 1 0
22 24 2 0
22 25 1 0
10 25 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 344.33Molecular Weight (Monoisotopic): 344.1121AlogP: 1.23#Rotatable Bonds: 4Polar Surface Area: 137.39Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.31CX Basic pKa: ┄CX LogP: -0.88CX LogD: -0.88Aromatic Rings: 1Heavy Atoms: 25QED Weighted: 0.70Np Likeness Score: -0.20
References 1. Zaryanova EV, Lozinskaya NA, Beznos OV, Volkova MS, Chesnokova NB, Zefirov NS.. (2017) Oxindole-based intraocular pressure reducing agents., 27 (16): [PMID:28687205 ] [10.1016/j.bmcl.2017.06.065 ]