7(E)-[(4-Quinoline)methylene]naltrexone

ID: ALA4104363

PubChem CID: 137657770

Max Phase: Preclinical

Molecular Formula: C30H28N2O4

Molecular Weight: 480.56

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1/C(=C/c2ccnc3ccccc23)C[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3CC2CC2)[C@H]1O5

Standard InChI:  InChI=1S/C30H28N2O4/c33-23-8-7-19-14-24-30(35)15-20(13-18-9-11-31-22-4-2-1-3-21(18)22)26(34)28-29(30,25(19)27(23)36-28)10-12-32(24)16-17-5-6-17/h1-4,7-9,11,13,17,24,28,33,35H,5-6,10,12,14-16H2/b20-13+/t24-,28+,29+,30-/m1/s1

Standard InChI Key:  BVSFSOYLQNVRIS-WOXOKXDRSA-N

Molfile:  

     RDKit          2D

 38 45  0  0  0  0  0  0  0  0999 V2000
    5.2498  -20.6031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6584  -19.8974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4326  -20.6031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6460  -21.2965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0364  -21.2965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8041  -21.7876    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2251  -19.1916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2498  -18.3744    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0364  -19.8974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4326  -19.1916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8289  -19.8974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4756  -19.8974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4632  -21.3089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6584  -17.6522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2192  -21.2965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8289  -18.8945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4756  -17.6439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1896  -18.0401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1814  -17.2229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2192  -19.8974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8842  -20.6031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0670  -19.1792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8718  -22.0270    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8065  -20.6031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7983  -22.0229    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9391  -18.7830    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6460  -22.2127    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.7014  -20.6085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1146  -19.9034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9400  -18.4964    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1186  -18.4937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7091  -19.1985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3440  -19.2078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9311  -19.9074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3305  -20.6128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1427  -20.6196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5538  -19.9153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1520  -19.2128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  1  1  0
  5  3  2  0
  6  4  1  0
  7  2  1  0
  8 16  1  0
  9  3  1  0
 10  9  1  0
  1 11  1  1
 12  2  1  0
 13  4  1  0
 14  8  1  0
 15  5  1  0
 16 11  1  0
 17 14  1  0
 18 17  1  0
 19 17  1  0
 20  9  2  0
 21 13  1  0
  2 22  1  1
 23 13  2  0
 24 20  1  0
 25 15  1  0
  7 26  1  6
  4 27  1  1
  5  6  1  0
  8  7  1  0
 21 12  1  0
 10  7  1  0
 24 15  2  0
 18 19  1  0
 21 28  2  0
 28 29  1  0
 29 34  2  0
 33 30  2  0
 30 31  1  0
 31 32  2  0
 32 29  1  0
 33 34  1  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4104363

    ---

Associated Targets(non-human)

Trichomonas vaginalis (2376 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 480.56Molecular Weight (Monoisotopic): 480.2049AlogP: 3.77#Rotatable Bonds: 3
Polar Surface Area: 82.89Molecular Species: BASEHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 10.11CX Basic pKa: 8.89CX LogP: 3.57CX LogD: 2.34
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.56Np Likeness Score: 0.80

References

1. Kutsumura N, Koyama Y, Nagumo Y, Nakajima R, Miyata Y, Yamamoto N, Saitoh T, Yoshida N, Iwata S, Nagase H..  (2017)  Antitrichomonal activity of δ opioid receptor antagonists, 7-benzylidenenaltrexone derivatives.,  25  (16): [PMID:28662966] [10.1016/j.bmc.2017.06.026]

Source