4-(1-((8R,9S,10R,13S,14S,16S,E)-17-ethylidene-10,13-dimethyl-3-oxo-2,3,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-16-yl)-1H-1,2,3-triazol-4-yl)butanenitrile

ID: ALA4104414

PubChem CID: 137656952

Max Phase: Preclinical

Molecular Formula: C27H36N4O

Molecular Weight: 432.61

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C/C=C1/[C@@H](n2cc(CCCC#N)nn2)C[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C

Standard InChI:  InChI=1S/C27H36N4O/c1-4-22-25(31-17-19(29-30-31)7-5-6-14-28)16-24-21-9-8-18-15-20(32)10-12-26(18,2)23(21)11-13-27(22,24)3/h4,15,17,21,23-25H,5-13,16H2,1-3H3/b22-4-/t21-,23+,24+,25+,26+,27-/m1/s1

Standard InChI Key:  KOKHDUXVXYDCMJ-VGUVVZNNSA-N

Molfile:  

     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
    3.6031  -19.3484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6031  -20.1698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3125  -20.5742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3125  -18.9316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0219  -19.3484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0184  -20.1698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7246  -20.5791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4388  -20.1758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7315  -18.9365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4423  -19.3593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4591  -17.7114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7369  -18.1133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1657  -18.1300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1524  -18.9528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9311  -19.2227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4272  -18.5640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9526  -17.8897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2430  -18.5764    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7167  -19.2493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4979  -19.0094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5112  -18.1840    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7381  -17.9190    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.2218  -17.1126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6808  -16.4924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1607  -17.3055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1442  -19.7736    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.4343  -18.5354    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.7245  -19.7570    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0146  -18.5271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8918  -20.5794    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.1553  -19.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9112  -19.1801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5686  -19.6711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3246  -19.3509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0776  -19.0290    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  6  2  0
  5  4  1  0
  5  6  1  0
  5  9  1  0
  6  7  1  0
  7  8  1  0
  8 10  1  0
  9 10  1  0
  9 12  1  0
 10 14  1  0
 13 11  1  0
 11 12  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 13  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 18  1  0
 16 18  1  1
 17 23  2  0
 23 24  1  0
 13 25  1  1
 14 26  1  6
 10 27  1  1
  9 28  1  6
  5 29  1  1
  2 30  2  0
 20 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  3  0
M  END

Alternative Forms

  1. Parent:

    ALA4104414

    ---

Associated Targets(non-human)

LLC-PK1 (2135 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 432.61Molecular Weight (Monoisotopic): 432.2889AlogP: 5.75#Rotatable Bonds: 4
Polar Surface Area: 71.57Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 0.40CX LogP: 4.69CX LogD: 4.69
Aromatic Rings: 1Heavy Atoms: 32QED Weighted: 0.45Np Likeness Score: 1.00

References

1. Lee D, Kim T, Kim KH, Ham J, Jang TS, Kang KS, Lee JW..  (2017)  Evaluation of guggulsterone derivatives as novel kidney cell protective agents against cisplatin-induced nephrotoxicity.,  27  (14): [PMID:28552338] [10.1016/j.bmcl.2017.05.033]

Source