The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(benzo[d][1,3]dioxol-5-ylmethyl)-1-(1-propylpiperidin-4-yl)-3-(3-(trifluoromethyl)phenyl)urea ID: ALA4104419
PubChem CID: 126696344
Max Phase: Preclinical
Molecular Formula: C24H28F3N3O3
Molecular Weight: 463.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCN1CCC(N(Cc2ccc3c(c2)OCO3)C(=O)Nc2cccc(C(F)(F)F)c2)CC1
Standard InChI: InChI=1S/C24H28F3N3O3/c1-2-10-29-11-8-20(9-12-29)30(15-17-6-7-21-22(13-17)33-16-32-21)23(31)28-19-5-3-4-18(14-19)24(25,26)27/h3-7,13-14,20H,2,8-12,15-16H2,1H3,(H,28,31)
Standard InChI Key: PLBHVOJLFQGHAQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
7.4524 -2.6950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4512 -3.5146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1593 -3.9235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8689 -3.5141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8661 -2.6914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1575 -2.2862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7432 -3.9226 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0358 -3.5135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3278 -3.9215 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0364 -2.6963 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6204 -3.5123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6252 -2.6943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9219 -2.2852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2114 -2.6898 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2088 -3.5079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9167 -3.9215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1550 -1.4690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8615 -1.0583 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.4461 -1.0625 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.1471 -0.6480 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.3271 -4.7387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6191 -5.1467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5056 -2.2779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7960 -2.6833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0902 -2.2715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9126 -4.7341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9163 -6.3685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6209 -5.9588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2039 -5.9595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2017 -5.1394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4211 -4.8881 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9409 -5.5529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4247 -6.2149 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
8 9 1 0
8 10 2 0
9 11 1 0
11 12 1 0
11 16 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
6 17 1 0
17 18 1 0
17 19 1 0
17 20 1 0
9 21 1 0
21 22 1 0
14 23 1 0
23 24 1 0
24 25 1 0
22 26 2 0
26 30 1 0
29 27 1 0
27 28 2 0
28 22 1 0
29 30 2 0
30 31 1 0
31 32 1 0
32 33 1 0
33 29 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 463.50Molecular Weight (Monoisotopic): 463.2083AlogP: 5.34#Rotatable Bonds: 6Polar Surface Area: 54.04Molecular Species: BASEHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.12CX Basic pKa: 9.00CX LogP: 4.46CX LogD: 2.85Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.63Np Likeness Score: -1.80
References 1. Hammill JT, Bhasin D, Scott DC, Min J, Chen Y, Lu Y, Yang L, Kim HS, Connelly MC, Hammill C, Holbrook G, Jeffries C, Singh B, Schulman BA, Guy RK.. (2018) Discovery of an Orally Bioavailable Inhibitor of Defective in Cullin Neddylation 1 (DCN1)-Mediated Cullin Neddylation., 61 (7): [PMID:29547693 ] [10.1021/acs.jmedchem.7b01282 ] 2. Hammill JT, Scott DC, Min J, Connelly MC, Holbrook G, Zhu F, Matheny A, Yang L, Singh B, Schulman BA, Guy RK.. (2018) Piperidinyl Ureas Chemically Control Defective in Cullin Neddylation 1 (DCN1)-Mediated Cullin Neddylation., 61 (7): [PMID:29547696 ] [10.1021/acs.jmedchem.7b01277 ]