The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Oxo-N-((3-oxo-3,4-dihydro-2H-benzo[1,4]oxazin-6-yl)methyl)-5-phenethyl-3,4-dihydrothieno[2,3-d]pyrimidine-2-carboxamide ID: ALA4104422
PubChem CID: 137657100
Max Phase: Preclinical
Molecular Formula: C24H20N4O4S
Molecular Weight: 460.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C1COc2ccc(CNC(=O)c3nc4scc(CCc5ccccc5)c4c(=O)[nH]3)cc2N1
Standard InChI: InChI=1S/C24H20N4O4S/c29-19-12-32-18-9-7-15(10-17(18)26-19)11-25-23(31)21-27-22(30)20-16(13-33-24(20)28-21)8-6-14-4-2-1-3-5-14/h1-5,7,9-10,13H,6,8,11-12H2,(H,25,31)(H,26,29)(H,27,28,30)
Standard InChI Key: CSGNSDMLNGXHMQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
11.7842 -9.4518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4933 -9.8604 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2024 -9.4518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2024 -8.6346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4933 -8.2260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7842 -8.6346 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9753 -8.3800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4598 -9.0432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9755 -9.7065 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.0793 -9.8604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0793 -10.6776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3702 -9.4518 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6611 -9.8604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8330 -8.2260 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8330 -7.4088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5380 -7.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2471 -7.4088 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2471 -8.2260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5380 -8.6346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9520 -8.6346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9520 -9.4518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2471 -9.8604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5380 -9.4518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5380 -6.1830 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4933 -7.4088 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2252 -7.6020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0240 -7.4294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2739 -6.6514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0717 -6.4808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3217 -5.7036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7726 -5.0972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9703 -5.2732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7240 -6.0502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
1 6 1 0
7 8 2 0
8 9 1 0
3 9 1 0
4 7 1 0
10 11 2 0
10 12 1 0
1 10 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
14 19 1 0
20 21 1 0
21 22 2 0
22 23 1 0
19 23 2 0
18 20 2 0
16 24 2 0
13 21 1 0
12 13 1 0
5 25 2 0
7 26 1 0
26 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 460.52Molecular Weight (Monoisotopic): 460.1205AlogP: 3.03#Rotatable Bonds: 6Polar Surface Area: 113.18Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.43CX Basic pKa: ┄CX LogP: 3.14CX LogD: 2.90Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.41Np Likeness Score: -1.20
References 1. Mahasenan KV, Bastian M, Gao M, Frost E, Ding D, Zorina-Lichtenwalter K, Jacobs J, Suckow MA, Schroeder VA, Wolter WR, Chang M, Mobashery S.. (2017) Exploitation of Conformational Dynamics in Imparting Selective Inhibition for Related Matrix Metalloproteinases., 8 (6): [PMID:28626528 ] [10.1021/acsmedchemlett.7b00130 ]