The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
sodium-(5S,8S)-1-(3-Chlorophenyl)-11-cyclohexyl-5-(cyclohexylmethyl)-3,6,11-trioxo-8-(((S)-2-oxopyrrolidin-3-yl)methyl)-2,10-dioxa-4,7-diazaundecane-9-sulfonate ID: ALA4105106
PubChem CID: 137656529
Max Phase: Preclinical
Molecular Formula: C31H43ClN3NaO9S
Molecular Weight: 670.22
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(N[C@@H](CC1CCCCC1)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(OC(=O)C1CCCCC1)S(=O)(=O)[O-])OCc1cccc(Cl)c1.[Na+]
Standard InChI: InChI=1S/C31H44ClN3O9S.Na/c32-24-13-7-10-21(16-24)19-43-31(39)35-25(17-20-8-3-1-4-9-20)28(37)34-26(18-23-14-15-33-27(23)36)30(45(40,41)42)44-29(38)22-11-5-2-6-12-22;/h7,10,13,16,20,22-23,25-26,30H,1-6,8-9,11-12,14-15,17-19H2,(H,33,36)(H,34,37)(H,35,39)(H,40,41,42);/q;+1/p-1/t23-,25-,26-,30?;/m0./s1
Standard InChI Key: FZNJYTCOJLEUPM-QCZFJXMQSA-M
Molfile:
RDKit 2D
47 49 0 0 0 0 0 0 0 0999 V2000
45.3402 -23.3050 0.0000 Na 0 0 0 0 0 15 0 0 0 0 0 0
44.2472 -24.0442 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.8390 -23.3307 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
43.4280 -24.0402 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.2664 -23.3618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2647 -24.1904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9775 -24.6014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6927 -24.1897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6926 -23.3605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9789 -22.9510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4024 -22.9460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1170 -23.3524 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.8311 -22.9379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5543 -23.3578 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.8264 -22.1170 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.2653 -22.9329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9799 -23.3434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2607 -22.1079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9747 -21.6933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9847 -24.1642 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.6985 -22.9359 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.4161 -23.3388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1301 -22.9243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4208 -24.1638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1354 -24.5743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2261 -25.3879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0350 -25.5676 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.4395 -24.8442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8897 -24.2342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6165 -25.9424 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.1254 -22.1035 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.8395 -21.6890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8348 -20.8639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.5588 -22.9203 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.5541 -22.0995 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.3467 -24.8133 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
41.6893 -22.1073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4013 -21.6964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4036 -20.8704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6878 -20.4570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9696 -20.8697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9772 -25.4222 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
44.5491 -20.4511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.5447 -19.6268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8274 -19.2176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1129 -19.6386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1207 -20.4614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 2 2 0
4 3 2 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
9 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
13 15 2 0
14 16 1 0
16 17 1 0
16 18 1 1
18 19 1 0
17 20 2 0
17 21 1 0
21 22 1 0
22 23 1 0
22 24 1 6
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
25 29 1 0
26 30 2 0
23 3 1 0
23 31 1 0
31 32 1 0
32 33 1 0
3 34 1 0
32 35 2 0
25 36 1 1
19 37 1 0
19 41 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
7 42 1 0
33 43 1 0
43 44 1 0
44 45 1 0
45 46 1 0
46 47 1 0
47 33 1 0
M CHG 2 1 1 34 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 670.22Molecular Weight (Monoisotopic): 669.2487AlogP: 4.25#Rotatable Bonds: 13Polar Surface Area: 177.20Molecular Species: ACIDHBA: 8HBD: 4#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: -0.85CX Basic pKa: ┄CX LogP: 3.52CX LogD: 2.19Aromatic Rings: 1Heavy Atoms: 45QED Weighted: 0.18Np Likeness Score: -0.10
References 1. Galasiti Kankanamalage AC, Kim Y, Rathnayake AD, Alliston KR, Butler MM, Cardinale SC, Bowlin TL, Groutas WC, Chang KO.. (2017) Design, Synthesis, and Evaluation of Novel Prodrugs of Transition State Inhibitors of Norovirus 3CL Protease., 60 (14): [PMID:28671827 ] [10.1021/acs.jmedchem.7b00497 ]