The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N,N'-(3,3'-(Piperazine-1,4-diyl)bis(3-oxopropane-3,1-diyl))bis(4-methoxybenzene-sulfonamide) ID: ALA4105631
PubChem CID: 137658349
Max Phase: Preclinical
Molecular Formula: C24H32N4O8S2
Molecular Weight: 568.67
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(S(=O)(=O)NCCC(=O)N2CCN(C(=O)CCNS(=O)(=O)c3ccc(OC)cc3)CC2)cc1
Standard InChI: InChI=1S/C24H32N4O8S2/c1-35-19-3-7-21(8-4-19)37(31,32)25-13-11-23(29)27-15-17-28(18-16-27)24(30)12-14-26-38(33,34)22-9-5-20(36-2)6-10-22/h3-10,25-26H,11-18H2,1-2H3
Standard InChI Key: BMBZBKZHSKZMLW-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 40 0 0 0 0 0 0 0 0999 V2000
29.3281 -19.4392 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.9236 -18.7335 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
28.5146 -19.4366 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.0253 -16.3934 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.4380 -17.1032 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.8465 -16.3909 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.9792 -17.5036 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.9792 -18.3208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6845 -18.7252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3898 -18.3208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.3898 -17.5036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6845 -17.0909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0969 -18.7304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0957 -19.5476 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.8052 -18.3228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5123 -18.7324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2206 -18.3249 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.2703 -17.0971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2679 -16.2799 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.5638 -17.5077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8549 -17.1012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1484 -17.5119 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7330 -17.5160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6360 -18.3269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0238 -17.1083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3192 -17.5204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3237 -18.3383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0387 -18.7423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7403 -18.3279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3408 -18.7447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0527 -18.3388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0572 -17.5177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3440 -17.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6350 -17.5124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6190 -18.7521 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.7664 -17.1117 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.9083 -18.3487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7694 -16.2945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
5 4 2 0
6 5 2 0
7 8 1 0
7 12 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
10 13 1 0
13 14 2 0
13 15 1 0
15 16 1 0
16 17 1 0
7 18 1 0
18 19 2 0
18 20 1 0
20 21 1 0
21 22 1 0
22 5 1 0
17 2 1 0
5 23 1 0
2 24 1 0
23 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 23 1 0
24 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 24 1 0
27 35 1 0
32 36 1 0
35 37 1 0
36 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 568.67Molecular Weight (Monoisotopic): 568.1662AlogP: 0.41#Rotatable Bonds: 12Polar Surface Area: 151.42Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.15CX Basic pKa: ┄CX LogP: -0.34CX LogD: -0.34Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.37Np Likeness Score: -0.90
References 1. Bassetto M, Leyssen P, Neyts J, Yerukhimovich MM, Frick DN, Courtney-Smith M, Brancale A.. (2017) In silico identification, design and synthesis of novel piperazine-based antiviral agents targeting the hepatitis C virus helicase., 125 [PMID:27810598 ] [10.1016/j.ejmech.2016.10.043 ]