N,N'-(3,3'-(Piperazine-1,4-diyl)bis(3-oxopropane-3,1-diyl))bis(4-methoxybenzene-sulfonamide)

ID: ALA4105631

PubChem CID: 137658349

Max Phase: Preclinical

Molecular Formula: C24H32N4O8S2

Molecular Weight: 568.67

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(S(=O)(=O)NCCC(=O)N2CCN(C(=O)CCNS(=O)(=O)c3ccc(OC)cc3)CC2)cc1

Standard InChI:  InChI=1S/C24H32N4O8S2/c1-35-19-3-7-21(8-4-19)37(31,32)25-13-11-23(29)27-15-17-28(18-16-27)24(30)12-14-26-38(33,34)22-9-5-20(36-2)6-10-22/h3-10,25-26H,11-18H2,1-2H3

Standard InChI Key:  BMBZBKZHSKZMLW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 38 40  0  0  0  0  0  0  0  0999 V2000
   29.3281  -19.4392    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.9236  -18.7335    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   28.5146  -19.4366    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.0253  -16.3934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.4380  -17.1032    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   20.8465  -16.3909    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.9792  -17.5036    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.9792  -18.3208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6845  -18.7252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3898  -18.3208    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.3898  -17.5036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6845  -17.0909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0969  -18.7304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0957  -19.5476    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.8052  -18.3228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5123  -18.7324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2206  -18.3249    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.2703  -17.0971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2679  -16.2799    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.5638  -17.5077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8549  -17.1012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1484  -17.5119    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.7330  -17.5160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6360  -18.3269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0238  -17.1083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3192  -17.5204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3237  -18.3383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0387  -18.7423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7403  -18.3279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3408  -18.7447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0527  -18.3388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0572  -17.5177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3440  -17.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6350  -17.5124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6190  -18.7521    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.7664  -17.1117    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9083  -18.3487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7694  -16.2945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  5  4  2  0
  6  5  2  0
  7  8  1  0
  7 12  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 10 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  1  0
 16 17  1  0
  7 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22  5  1  0
 17  2  1  0
  5 23  1  0
  2 24  1  0
 23 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 23  1  0
 24 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 24  1  0
 27 35  1  0
 32 36  1  0
 35 37  1  0
 36 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4105631

    ---

Associated Targets(Human)

Huh-5-2 (386 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 568.67Molecular Weight (Monoisotopic): 568.1662AlogP: 0.41#Rotatable Bonds: 12
Polar Surface Area: 151.42Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 10.15CX Basic pKa: CX LogP: -0.34CX LogD: -0.34
Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.37Np Likeness Score: -0.90

References

1. Bassetto M, Leyssen P, Neyts J, Yerukhimovich MM, Frick DN, Courtney-Smith M, Brancale A..  (2017)  In silico identification, design and synthesis of novel piperazine-based antiviral agents targeting the hepatitis C virus helicase.,  125  [PMID:27810598] [10.1016/j.ejmech.2016.10.043]

Source