(E)-3-[4-((Z)-1,2-Diphenyl-but-1-enyl)-phenyl]-N,N-diethyl-acrylamide

ID: ALA41069

PubChem CID: 9801632

Max Phase: Preclinical

Molecular Formula: C29H31NO

Molecular Weight: 409.57

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC/C(=C(\c1ccccc1)c1ccc(/C=C/C(=O)N(CC)CC)cc1)c1ccccc1

Standard InChI:  InChI=1S/C29H31NO/c1-4-27(24-13-9-7-10-14-24)29(25-15-11-8-12-16-25)26-20-17-23(18-21-26)19-22-28(31)30(5-2)6-3/h7-22H,4-6H2,1-3H3/b22-19+,29-27-

Standard InChI Key:  LEANVSLVLHRVSO-SWATYJQJSA-N

Molfile:  

     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
    3.5667   -4.6125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2875   -5.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2667   -0.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2667   -0.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5667   -3.7875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5542   -1.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9792    0.3458    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8542   -5.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0000   -4.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5500    0.3333    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2792   -3.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8542   -3.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5625   -2.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8417   -2.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2792   -2.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2875   -5.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6917   -0.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9750    1.1708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9917   -3.7875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8542   -5.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1417   -4.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7125   -5.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0042   -6.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4042    0.3458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6875    1.5833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7000   -3.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4292   -5.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1417   -6.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4250   -4.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4292   -5.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4250   -3.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  4  1  0
  4  6  2  0
  5  1  1  0
  6 13  1  0
  7  3  1  0
  8  1  1  0
  9  2  1  0
 10  3  2  0
 11  5  2  0
 12  5  1  0
 13 14  1  0
 14 12  2  0
 15 11  1  0
 16  2  1  0
 17  7  1  0
 18  7  1  0
 19  9  1  0
 20  8  1  0
 21  8  2  0
 22  9  2  0
 23 16  1  0
 24 17  1  0
 25 18  1  0
 26 19  2  0
 27 21  1  0
 28 20  2  0
 29 22  1  0
 30 27  2  0
 31 29  2  0
 15 13  2  0
 30 28  1  0
 26 31  1  0
M  END

Associated Targets(Human)

Ishikawa (877 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 409.57Molecular Weight (Monoisotopic): 409.2406AlogP: 6.94#Rotatable Bonds: 8
Polar Surface Area: 20.31Molecular Species: NEUTRALHBA: 1HBD:
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 7.01CX LogD: 7.01
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.29Np Likeness Score: -0.26

References

1. Willson TM, Henke BR, Momtahen TM, Charifson PS, Batchelor KW, Lubahn DB, Moore LB, Oliver BB, Sauls HR, Triantafillou JA..  (1994)  3-[4-(1,2-Diphenylbut-1-enyl)phenyl]acrylic acid: a non-steroidal estrogen with functional selectivity for bone over uterus in rats.,  37  (11): [PMID:8201587] [10.1021/jm00037a002]

Source