US9320722, 9

ID: ALA4107656

PubChem CID: 126961675

Max Phase: Preclinical

Molecular Formula: C18H24N4O4S

Molecular Weight: 392.48

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)Nc1cccc(Nc2ccc(S(=O)(=O)NC(C)C)cc2[N+](=O)[O-])c1

Standard InChI:  InChI=1S/C18H24N4O4S/c1-12(2)19-14-6-5-7-15(10-14)20-17-9-8-16(11-18(17)22(23)24)27(25,26)21-13(3)4/h5-13,19-21H,1-4H3

Standard InChI Key:  HTISCZFVKHVEDO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 28  0  0  0  0  0  0  0  0999 V2000
    3.6331   -3.6060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5548   -3.6021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5972   -1.5031    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5951   -3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2935   -3.7495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2883   -5.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5847   -6.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8863   -5.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8915   -3.7585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1954   -3.0153    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2317   -3.6204    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2017   -1.8153    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5795   -7.5048    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6169   -8.1081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5759   -8.7048    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2777   -8.2516    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2725   -9.7524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2315  -10.3494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3098  -10.3556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 16 17  1  0
 17 18  2  0
 17 19  1  0
 14 20  1  0
 20 21  2  0
 20 22  2  0
 20 23  1  0
 23 24  1  0
 24 25  1  0
 24 26  1  0
  9 27  2  0
 27  5  1  0
M  CHG  2  17   1  19  -1
M  END

Alternative Forms

  1. Parent:

    ALA4107656

    ---

Associated Targets(Human)

ALDH3A1 Tchem Aldehyde dehydrogenase dimeric NADP-preferring (307 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 392.48Molecular Weight (Monoisotopic): 392.1518AlogP: 3.85#Rotatable Bonds: 8
Polar Surface Area: 113.37Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 10.05CX Basic pKa: 5.19CX LogP: 4.50CX LogD: 4.50
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.46Np Likeness Score: -1.89

References

1.  (2016)  Regulators of aldehyde dehydrogenase ALDH3A1 and related therapeutic methods, 

Source

Source(1):