US9162991, 15p

ID: ALA4108576

PubChem CID: 137656370

Max Phase: Preclinical

Molecular Formula: C30H23N3O4

Molecular Weight: 489.53

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(/C=C/C(=O)N2ONc3ccccc32)cc1)OCC1c2ccccc2-c2ccccc21

Standard InChI:  InChI=1S/C30H23N3O4/c34-29(33-28-12-6-5-11-27(28)32-37-33)18-15-20-13-16-21(17-14-20)31-30(35)36-19-26-24-9-3-1-7-22(24)23-8-2-4-10-25(23)26/h1-18,26,32H,19H2,(H,31,35)/b18-15+

Standard InChI Key:  YJNRBCRGBCXSER-OBGWFSINSA-N

Molfile:  

     RDKit          2D

 37 42  0  0  0  0  0  0  0  0999 V2000
    6.7235   -1.1108    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3509   -2.2515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3538   -3.3681    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8224   -3.0588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8263   -4.1733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2935   -3.8612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7568   -2.4346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2242   -2.1193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6857   -0.6912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1530   -0.3759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9577   -1.2661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.6145    1.0522    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.7220    2.2419    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5994    3.4585    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.0268    2.9999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3232    3.7544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6248    3.0089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6301    1.5089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3336    0.7544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0320    1.4999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7529   -1.3200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2858   -1.6321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8823   -2.5608    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8794   -1.4442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4133   -1.7530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3114   -2.9665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5701   -4.1788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0400   -5.5491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5318   -5.7059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4135   -4.4923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8032   -3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 12  1  0
 20 15  1  0
  7 21  1  0
 21 22  2  0
 22  4  1  0
  2 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 25  1  0
 37 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4108576

    ---

Associated Targets(non-human)

TGM2 Protein-glutamine gamma-glutamyltransferase 2 (55 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 489.53Molecular Weight (Monoisotopic): 489.1689AlogP: 6.37#Rotatable Bonds: 5
Polar Surface Area: 79.90Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.54CX Basic pKa: 2.73CX LogP: 6.36CX LogD: 6.36
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.32Np Likeness Score: -0.45

References

1.  (2015)  Cinnamoyl inhibitors of transglutaminase, 

Source

Source(1):