The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9162991, 15p ID: ALA4108576
PubChem CID: 137656370
Max Phase: Preclinical
Molecular Formula: C30H23N3O4
Molecular Weight: 489.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccc(/C=C/C(=O)N2ONc3ccccc32)cc1)OCC1c2ccccc2-c2ccccc21
Standard InChI: InChI=1S/C30H23N3O4/c34-29(33-28-12-6-5-11-27(28)32-37-33)18-15-20-13-16-21(17-14-20)31-30(35)36-19-26-24-9-3-1-7-22(24)23-8-2-4-10-25(23)26/h1-18,26,32H,19H2,(H,31,35)/b18-15+
Standard InChI Key: YJNRBCRGBCXSER-OBGWFSINSA-N
Molfile:
RDKit 2D
37 42 0 0 0 0 0 0 0 0999 V2000
6.7235 -1.1108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3509 -2.2515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3538 -3.3681 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8224 -3.0588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8263 -4.1733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2935 -3.8612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7568 -2.4346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2242 -2.1193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6857 -0.6912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1530 -0.3759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9577 -1.2661 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6145 1.0522 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7220 2.2419 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5994 3.4585 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.0268 2.9999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3232 3.7544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6248 3.0089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6301 1.5089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3336 0.7544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0320 1.4999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7529 -1.3200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2858 -1.6321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8823 -2.5608 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8794 -1.4442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -1.7530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3114 -2.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5701 -4.1788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0400 -5.5491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5318 -5.7059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4135 -4.4923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
10 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 12 1 0
20 15 1 0
7 21 1 0
21 22 2 0
22 4 1 0
2 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 25 1 0
37 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 489.53Molecular Weight (Monoisotopic): 489.1689AlogP: 6.37#Rotatable Bonds: 5Polar Surface Area: 79.90Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.54CX Basic pKa: 2.73CX LogP: 6.36CX LogD: 6.36Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.32Np Likeness Score: -0.45
References 1. (2015) Cinnamoyl inhibitors of transglutaminase,