The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9428478, TG6-235 ID: ALA4109345
PubChem CID: 129626256
Max Phase: Preclinical
Molecular Formula: C22H22FN3O4
Molecular Weight: 411.43
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)C1CN(c2ccc(OC)cc2)CCN1C(=O)c1cc2cc(F)ccc2[nH]1
Standard InChI: InChI=1S/C22H22FN3O4/c1-29-17-6-4-16(5-7-17)25-9-10-26(20(13-25)22(28)30-2)21(27)19-12-14-11-15(23)3-8-18(14)24-19/h3-8,11-12,20,24H,9-10,13H2,1-2H3
Standard InChI Key: FDDLWYZMTTZGSV-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
5.9876 -8.3412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7876 -8.3345 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0436 -7.0311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6491 -5.9950 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5428 -7.0227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7883 -8.3192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2883 -8.3139 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4572 -7.0123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2973 -5.7159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7974 -5.7210 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5497 -4.4224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7497 -4.4245 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -1.7530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 2.7000 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3114 -2.9665 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4666 -9.6110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2768 -10.9139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4798 -12.2092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9798 -12.2016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7395 -13.4959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9394 -13.4882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7232 -10.8987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9666 -9.6035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
3 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 5 1 0
10 11 1 0
11 12 2 0
11 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 1 0
17 19 2 0
19 20 1 0
20 21 2 0
21 15 1 0
21 22 1 0
22 13 1 0
7 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 1 0
26 29 1 0
29 30 2 0
30 23 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 411.43Molecular Weight (Monoisotopic): 411.1594AlogP: 2.82#Rotatable Bonds: 4Polar Surface Area: 74.87Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 3.10CX LogP: 2.85CX LogD: 2.85Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.67Np Likeness Score: -1.44
References 1. (2016) Piperazine derivatives, compositions, and uses related thereto,