US9243038, 20

ID: ALA4110918

PubChem CID: 124037319

Max Phase: Preclinical

Molecular Formula: C41H55N7O7

Molecular Weight: 757.93

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NCCCC[C@@H]1NC(=O)/C=C/C(=O)NC(C(N)=O)CCCCNC(=O)[C@@H](Cc2ccc(C(=O)c3ccccc3)cc2)NC(=O)[C@H](CC2CCCCC2)NC1=O

Standard InChI:  InChI=1S/C41H55N7O7/c42-23-9-7-16-32-40(54)48-34(25-27-11-3-1-4-12-27)41(55)47-33(26-28-17-19-30(20-18-28)37(51)29-13-5-2-6-14-29)39(53)44-24-10-8-15-31(38(43)52)45-35(49)21-22-36(50)46-32/h2,5-6,13-14,17-22,27,31-34H,1,3-4,7-12,15-16,23-26,42H2,(H2,43,52)(H,44,53)(H,45,49)(H,46,50)(H,47,55)(H,48,54)/b22-21+/t31?,32-,33+,34-/m0/s1

Standard InChI Key:  BHZABWWULWHRIY-ACWJXPKNSA-N

Molfile:  

     RDKit          2D

 55 58  0  0  1  0  0  0  0  0999 V2000
   -0.5427    9.0131    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4249    7.8189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9419    7.1990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0893    5.7054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4561    5.0854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6037    3.5908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3688    2.7690    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0696    3.4737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0569    4.6736    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2150    2.7412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4570    3.5378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7917    2.9053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7630    3.6101    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9824    1.4153    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8525    0.3897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6007   -0.9001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4617   -2.4060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6088   -3.6718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3062   -4.4788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2068   -4.7156    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3791   -3.7561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4613   -4.2744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3917   -2.2668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2781   -1.2680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1486   -1.7339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2668   -0.7340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6918   -1.2024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9987   -2.6707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8806   -3.6706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4556   -3.2022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4235   -3.1422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3194   -2.3438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7285   -4.6117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1519   -5.0851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4537   -6.5544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3321   -7.5505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9087   -7.0772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6069   -5.6079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9073   -2.1055    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6788   -0.8137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8766   -0.8859    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0761    0.5435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6096    0.8504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6083   -0.2675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8604    0.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8590   -1.0818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3889   -2.5062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0797   -2.8114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0783   -1.6921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2027    1.5500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9705    3.0239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9134    3.7663    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3719    0.6102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6249   -0.3289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9318    1.7266    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  6  5  1  1
  6  7  1  0
  7  8  1  0
  8  9  2  0
  8 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  1  1
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 28 31  1  0
 31 32  2  0
 31 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 33  1  0
 23 39  1  0
 39 40  1  0
 40 41  2  0
 40 42  1  0
 42 43  1  6
 43 44  1  0
 44 45  1  0
 45 46  1  0
 46 47  1  0
 47 48  1  0
 48 49  1  0
 49 44  1  0
 42 50  1  0
 50 51  1  0
 51  6  1  0
 51 52  2  0
 15 53  1  0
 53 54  2  0
 53 55  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4110918

    ---

Associated Targets(Human)

IDE Tchem Insulin-degrading enzyme (806 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Ide Insulin-degrading enzyme (20 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 757.93Molecular Weight (Monoisotopic): 757.4163AlogP: 1.84#Rotatable Bonds: 11
Polar Surface Area: 231.68Molecular Species: BASEHBA: 8HBD: 7
#RO5 Violations: 2HBA (Lipinski): 14HBD (Lipinski): 9#RO5 Violations (Lipinski): 3
CX Acidic pKa: 11.99CX Basic pKa: 10.20CX LogP: 2.02CX LogD: -0.58
Aromatic Rings: 2Heavy Atoms: 55QED Weighted: 0.13Np Likeness Score: 0.50

References

1.  (2016)  Macrocyclic insulin-degrading enzyme (IDE) inhibitors and uses thereof, 

Source

Source(1):