US9320722, 11

ID: ALA4111180

PubChem CID: 16364337

Max Phase: Preclinical

Molecular Formula: C14H13F2N3O5S

Molecular Weight: 373.34

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CNS(=O)(=O)c1ccc(Nc2ccc(OC(F)F)cc2)c([N+](=O)[O-])c1

Standard InChI:  InChI=1S/C14H13F2N3O5S/c1-17-25(22,23)11-6-7-12(13(8-11)19(20)21)18-9-2-4-10(5-3-9)24-14(15)16/h2-8,14,17-18H,1H3

Standard InChI Key:  SCGYGKDWDXBTRO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 25 26  0  0  0  0  0  0  0  0999 V2000
    3.6390   -3.6012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5997   -3.0012    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5988   -1.5004    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.6378   -0.9001    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6383   -2.0999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5973    1.5031    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5951    3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8916    3.7585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8864    5.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5847    6.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5765    7.5048    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2731    8.2489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2665    9.4488    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2370    7.6435    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2883    5.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2935    3.7495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5972   -1.5031    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5955   -2.7031    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6375   -0.9049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  3  5  2  0
  3  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  1  0
 14 19  1  0
 19 20  2  0
 20 11  1  0
  9 21  1  0
 21 22  2  0
 22  6  1  0
 21 23  1  0
 23 24  2  0
 23 25  1  0
M  CHG  2  23   1  25  -1
M  END

Alternative Forms

  1. Parent:

Associated Targets(Human)

ALDH3A1 Tchem Aldehyde dehydrogenase dimeric NADP-preferring (307 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 373.34Molecular Weight (Monoisotopic): 373.0544AlogP: 2.85#Rotatable Bonds: 7
Polar Surface Area: 110.57Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 10.07CX Basic pKa: CX LogP: 4.25CX LogD: 4.25
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.57Np Likeness Score: -2.28

References

1.  (2016)  Regulators of aldehyde dehydrogenase ALDH3A1 and related therapeutic methods, 

Source

Source(1):