US9320722, 20

ID: ALA4112008

PubChem CID: 9533727

Max Phase: Preclinical

Molecular Formula: C15H11F3N2O6S

Molecular Weight: 404.32

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)Nc1ccc(Oc2ccc(S(=O)(=O)C(F)(F)F)cc2[N+](=O)[O-])cc1

Standard InChI:  InChI=1S/C15H11F3N2O6S/c1-9(21)19-10-2-4-11(5-3-10)26-14-7-6-12(8-13(14)20(22)23)27(24,25)15(16,17)18/h2-8H,1H3,(H,19,21)

Standard InChI Key:  KMLYOGCQTNVFEX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 28  0  0  0  0  0  0  0  0999 V2000
    1.5548   -3.6021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6331   -3.6060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6003    1.4977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8990    0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8939   -0.7546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1903   -1.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4920   -0.7636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4972    0.7364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2007    1.4909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2091    2.9917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2512    3.5866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1730    3.5971    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7891   -1.5185    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8302   -0.9218    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7931   -0.3185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7849   -3.0193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8220   -3.6229    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7438   -3.6160    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7809   -4.2193    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
 15 16  1  0
 16 17  2  0
 16 18  1  0
 13 19  1  0
 19 20  2  0
 19 21  2  0
 19 22  1  0
 22 23  1  0
 22 24  1  0
 22 25  1  0
  8 26  1  0
 26 27  2  0
 27  5  1  0
M  CHG  2  16   1  18  -1
M  END

Alternative Forms

  1. Parent:

Associated Targets(Human)

ALDH3A1 Tchem Aldehyde dehydrogenase dimeric NADP-preferring (307 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 404.32Molecular Weight (Monoisotopic): 404.0290AlogP: 3.64#Rotatable Bonds: 5
Polar Surface Area: 115.61Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.60CX LogD: 3.60
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.60Np Likeness Score: -1.59

References

1.  (2016)  Regulators of aldehyde dehydrogenase ALDH3A1 and related therapeutic methods, 

Source

Source(1):