US9394289, 94

ID: ALA4112693

PubChem CID: 129012567

Max Phase: Preclinical

Molecular Formula: C29H33N5O2

Molecular Weight: 483.62

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1(C)CC=C(c2cc(C3(C#N)C[C@@]4(C)CC[C@](C)(C3)O4)ccc2NC(=O)c2nc(C#N)c[nH]2)CC1

Standard InChI:  InChI=1S/C29H33N5O2/c1-26(2)9-7-19(8-10-26)22-13-20(29(18-31)16-27(3)11-12-28(4,17-29)36-27)5-6-23(22)34-25(35)24-32-15-21(14-30)33-24/h5-7,13,15H,8-12,16-17H2,1-4H3,(H,32,33)(H,34,35)/t27-,28-/m1/s1

Standard InChI Key:  QIMOBKDZNGIPRY-VSGBNLITSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  1  0  0  0  0  0999 V2000
    4.6954   -8.5496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4961   -8.5931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8849   -9.6257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2297   -7.2846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4633   -5.9952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9634   -6.0140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2299   -7.3225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9963   -8.6120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1946   -4.7251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9261   -3.4156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1577   -2.1273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3421   -2.1486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0736   -3.4582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3052   -4.7464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0398   -6.0552    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5405   -6.0744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1534   -5.0428    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2750   -7.3832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7538   -7.5421    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0448   -9.0136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7352   -9.7451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6349   -8.7256    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4047   -9.6424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4939  -10.1460    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8975   -0.8028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9488    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8393    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2943   -1.0691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8063   -1.3319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6568   -0.6386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.6568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6393   -0.3587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6421    0.6933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0947    1.4779    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4138   -0.8384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6135   -0.8666    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  2  1  0
  6  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 18  1  0
 20 23  1  0
 23 24  3  0
 11 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  6
 27 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  6
 31 33  1  0
 33 25  1  0
 31 34  1  0
 34 27  1  0
 25 35  1  0
 35 36  3  0
M  END

Alternative Forms

  1. Parent:

    ALA4112693

    ---

Associated Targets(non-human)

Csf1r Macrophage colony-stimulating factor 1 receptor (491 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 483.62Molecular Weight (Monoisotopic): 483.2634AlogP: 6.01#Rotatable Bonds: 4
Polar Surface Area: 114.59Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 7.44CX Basic pKa: CX LogP: 5.06CX LogD: 4.79
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.55Np Likeness Score: 0.12

References

1.  (2016)  Inhibitors of c-fms kinase, 

Source

Source(1):