The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ENSARTINIB ID: ALA4113131
Cas Number: 1370651-20-9
PubChem CID: 56960363
Max Phase: Phase
Molecular Formula: C26H27Cl2FN6O3
Molecular Weight: 561.45
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Synonyms: Ensartinib | X-396 | X-396 | ensartinib|1370651-20-9|Ensartinib (X-396)|Ensartinib [INN]|SMA5ZS5B22|X396|C26H27Cl2FN6O3|Ensartinib (USAN)|ENSARTINIB [USAN]|3-Pyridazinecarboxamide, 6-amino-5-((1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy)-N-(4-(((3R,5S)-3,5-dimethyl-1-piperazinyl)carbonyl)phenyl)|6-Amino-5-((1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy)- N-(4-((3R,5S)-3,5-dimethylpiperazine- 1-carbonyl)phenyl)pyridazine-3-carboxamide|6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-[4-[(3R,5S) Show More⌵
Synonyms from Alternative Forms(3): Ensartinib dihydrochloride | Ensartinib hydrochloride | X-396 HCl
Canonical SMILES: C[C@@H]1CN(C(=O)c2ccc(NC(=O)c3cc(O[C@H](C)c4c(Cl)ccc(F)c4Cl)c(N)nn3)cc2)C[C@H](C)N1
Standard InChI: InChI=1S/C26H27Cl2FN6O3/c1-13-11-35(12-14(2)31-13)26(37)16-4-6-17(7-5-16)32-25(36)20-10-21(24(30)34-33-20)38-15(3)22-18(27)8-9-19(29)23(22)28/h4-10,13-15,31H,11-12H2,1-3H3,(H2,30,34)(H,32,36)/t13-,14+,15-/m1/s1
Standard InChI Key: GLYMPHUVMRFTFV-QLFBSQMISA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
-5.4740 -0.1295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1885 -0.5420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1885 -1.3671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4740 -1.7796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7596 -1.3671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7596 -0.5420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0451 -0.1295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0451 -1.7796 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-3.3306 -0.5420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3306 1.1080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0451 0.6955 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6162 0.6955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6162 2.3455 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.3306 1.9330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9017 1.1080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9017 1.9330 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.1871 -0.1295 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1871 0.6955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4728 1.1080 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2417 -0.1295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2417 0.6955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9562 1.1080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9562 -0.5420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6706 -0.1295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6706 0.6955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3851 -0.5420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0996 -0.1295 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0996 0.6955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8140 1.1080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8140 -0.5420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5285 -0.1295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5285 0.6955 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.4740 -2.6046 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-5.4740 0.6955 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-4.0657 2.3076 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3851 -1.3670 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8140 1.9330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2430 -0.5420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
1 6 2 0
5 8 1 0
7 6 1 0
10 11 1 0
10 12 1 0
11 7 1 0
7 9 1 6
13 14 1 0
15 16 1 0
13 16 2 0
14 10 2 0
12 15 2 0
17 18 2 0
15 18 1 0
20 21 2 0
19 21 1 0
19 18 1 0
23 24 2 0
24 25 1 0
22 25 2 0
20 23 1 0
22 21 1 0
26 27 1 0
27 28 1 0
24 26 1 0
30 31 1 0
31 32 1 0
29 32 1 0
27 30 1 0
29 28 1 0
4 33 1 0
1 34 1 0
14 35 1 0
26 36 2 0
29 37 1 1
31 38 1 1
M END
Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: YesAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 561.45Molecular Weight (Monoisotopic): 560.1506AlogP: 4.72#Rotatable Bonds: 6Polar Surface Area: 122.47Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.82CX Basic pKa: 8.00CX LogP: 3.95CX LogD: 3.26Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.37Np Likeness Score: -1.18
References 1. Unpublished dataset, 2. (2015) Substituted pyridazine carboxamide compounds, 3. USP Dictionary of USAN and International Names (2010 edition) and USAN registrations 2007-date, 4. Kong X, Pan P, Sun H, Xia H, Wang X, Li Y, Hou T.. (2019) Drug Discovery Targeting Anaplastic Lymphoma Kinase (ALK)., 62 (24): [PMID:31419130 ] [10.1021/acs.jmedchem.9b00446 ]