US9320722, 5

ID: ALA4113853

PubChem CID: 5035142

Max Phase: Preclinical

Molecular Formula: C15H14F3N3O4S

Molecular Weight: 389.36

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(C)c1ccc(Nc2ccc(S(=O)(=O)C(F)(F)F)cc2[N+](=O)[O-])cc1

Standard InChI:  InChI=1S/C15H14F3N3O4S/c1-20(2)11-5-3-10(4-6-11)19-13-8-7-12(9-14(13)21(22)23)26(24,25)15(16,17)18/h3-9,19H,1-2H3

Standard InChI Key:  AYXOQXGUVHPODV-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 26 27  0  0  0  0  0  0  0  0999 V2000
    2.5956   -2.7031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6375   -0.9049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6003    1.4977    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8990    0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8939   -0.7546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1903   -1.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4920   -0.7636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4972    0.7364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2007    1.4909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2091    2.9917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2512    3.5866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1730    3.5971    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7891   -1.5185    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8302   -0.9218    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7931   -0.3185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7849   -3.0193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8220   -3.6229    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7438   -3.6160    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7809   -4.2193    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 14 15  1  0
 15 16  2  0
 15 17  1  0
 12 18  1  0
 18 19  2  0
 18 20  2  0
 18 21  1  0
 21 22  1  0
 21 23  1  0
 21 24  1  0
  7 25  1  0
 25 26  2  0
 26  4  1  0
M  CHG  2  15   1  17  -1
M  END

Alternative Forms

  1. Parent:

Associated Targets(Human)

ALDH3A1 Tchem Aldehyde dehydrogenase dimeric NADP-preferring (307 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 389.36Molecular Weight (Monoisotopic): 389.0657AlogP: 3.70#Rotatable Bonds: 5
Polar Surface Area: 92.55Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.08CX LogP: 5.71CX LogD: 5.69
Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.62Np Likeness Score: -1.83

References

1.  (2016)  Regulators of aldehyde dehydrogenase ALDH3A1 and related therapeutic methods, 

Source

Source(1):