The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9452990, 90 ID: ALA4114217
PubChem CID: 118046356
Max Phase: Preclinical
Molecular Formula: C26H30FN7O3
Molecular Weight: 507.57
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCN[C@H](CC(=O)N1CCN(c2nc(N)c3cc(OC)c(OC)c(F)c3n2)CC1)c1ccc(C#N)cc1
Standard InChI: InChI=1S/C26H30FN7O3/c1-4-30-19(17-7-5-16(15-28)6-8-17)14-21(35)33-9-11-34(12-10-33)26-31-23-18(25(29)32-26)13-20(36-2)24(37-3)22(23)27/h5-8,13,19,30H,4,9-12,14H2,1-3H3,(H2,29,31,32)/t19-/m1/s1
Standard InChI Key: FQQPKJKIBNLDSF-LJQANCHMSA-N
Molfile:
RDKit 2D
37 40 0 0 1 0 0 0 0 0999 V2000
10.1276 -3.1674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0876 -3.7661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0848 -5.2669 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7840 -6.0157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4870 -5.2605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4915 -3.7597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5328 -3.1632 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1945 -3.0045 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1969 -1.5045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8991 -0.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 -1.5004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5965 -3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8943 -3.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 2.7000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1953 1.5031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.1936 2.7031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1953 -1.5031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.1936 -2.7031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -2.7000 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7795 -7.5165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0747 -8.2731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0672 -9.7731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7644 -10.5165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4691 -9.7600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4767 -8.2600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7568 -12.0173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7507 -13.2173 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
4 3 1 1
4 5 1 0
5 6 1 0
6 7 2 0
6 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 8 1 0
11 14 1 0
14 15 2 0
15 16 1 0
16 17 1 0
16 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
20 23 1 0
23 24 1 0
24 25 1 0
23 26 2 0
26 27 1 0
26 28 1 0
28 18 1 0
28 29 2 0
29 14 1 0
4 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
33 36 1 0
36 37 3 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 507.57Molecular Weight (Monoisotopic): 507.2394AlogP: 2.63#Rotatable Bonds: 8Polar Surface Area: 129.63Molecular Species: BASEHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.68CX LogP: 2.62CX LogD: 1.33Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.47Np Likeness Score: -1.08
References 1. (2016) Complement pathway modulators and uses thereof, 2. Iyer A, Xu W, Reid RC, Fairlie DP.. (2018) Chemical Approaches to Modulating Complement-Mediated Diseases., 61 (8): [PMID:28977749 ] [10.1021/acs.jmedchem.7b00882 ]