US9351965, 89

ID: ALA4114328

PubChem CID: 57411381

Max Phase: Preclinical

Molecular Formula: C30H29N5O3

Molecular Weight: 507.59

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(-c2n[nH]c3ccc(C(=O)N[C@@H]4CCC[C@](O)(Cn5c(=O)ccc6ccccc65)C4)cc23)ccn1

Standard InChI:  InChI=1S/C30H29N5O3/c1-19-15-21(12-14-31-19)28-24-16-22(8-10-25(24)33-34-28)29(37)32-23-6-4-13-30(38,17-23)18-35-26-7-3-2-5-20(26)9-11-27(35)36/h2-3,5,7-12,14-16,23,38H,4,6,13,17-18H2,1H3,(H,32,37)(H,33,34)/t23-,30-/m1/s1

Standard InChI Key:  QLVZQDRQARHZMR-WVXBCFDCSA-N

Molfile:  

     RDKit          2D

 38 43  0  0  1  0  0  0  0  0999 V2000
    9.2410   10.7006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9590    9.5342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0455    8.4999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6934    7.0470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2542    6.6181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1677    7.6523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5201    9.1104    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.6994    5.9334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1909    6.0925    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.8032    4.7231    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.6905    3.7184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6928    2.2184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3949    1.4664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0947    2.2143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0924    3.7144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3903    4.4664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7945    1.4645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7944    0.2645    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4947    2.2147    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1946    1.4649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8943    2.2128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5965    1.4608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5989   -0.0392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9393   -1.3437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3383    1.3500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -3.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1969   -0.0351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  4  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16  8  1  0
 16 11  1  0
 14 17  1  0
 17 18  2  0
 17 19  1  0
 20 19  1  1
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  6
 24 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 28 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 27  1  0
 37 32  1  0
 24 38  1  0
 38 20  1  0
M  END

Associated Targets(non-human)

Mapk1 MAP kinase ERK2 (650 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 507.59Molecular Weight (Monoisotopic): 507.2270AlogP: 4.35#Rotatable Bonds: 5
Polar Surface Area: 112.90Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.18CX Basic pKa: 4.37CX LogP: 2.87CX LogD: 2.87
Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.33Np Likeness Score: -0.80

References

1.  (2016)  Indazole derivatives useful as ERK inhibitors, 

Source

Source(1):