The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9351965, 89 ID: ALA4114328
PubChem CID: 57411381
Max Phase: Preclinical
Molecular Formula: C30H29N5O3
Molecular Weight: 507.59
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(-c2n[nH]c3ccc(C(=O)N[C@@H]4CCC[C@](O)(Cn5c(=O)ccc6ccccc65)C4)cc23)ccn1
Standard InChI: InChI=1S/C30H29N5O3/c1-19-15-21(12-14-31-19)28-24-16-22(8-10-25(24)33-34-28)29(37)32-23-6-4-13-30(38,17-23)18-35-26-7-3-2-5-20(26)9-11-27(35)36/h2-3,5,7-12,14-16,23,38H,4,6,13,17-18H2,1H3,(H,32,37)(H,33,34)/t23-,30-/m1/s1
Standard InChI Key: QLVZQDRQARHZMR-WVXBCFDCSA-N
Molfile:
RDKit 2D
38 43 0 0 1 0 0 0 0 0999 V2000
9.2410 10.7006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9590 9.5342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0455 8.4999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6934 7.0470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2542 6.6181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1677 7.6523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5201 9.1104 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6994 5.9334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1909 6.0925 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.8032 4.7231 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6905 3.7184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6928 2.2184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3949 1.4664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0947 2.2143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0924 3.7144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3903 4.4664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7945 1.4645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7944 0.2645 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4947 2.2147 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1946 1.4649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8943 2.2128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5965 1.4608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5989 -0.0392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9393 -1.3437 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3383 1.3500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1969 -0.0351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
4 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 8 1 0
16 11 1 0
14 17 1 0
17 18 2 0
17 19 1 0
20 19 1 1
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 6
24 26 1 0
26 27 1 0
27 28 1 0
28 29 2 0
28 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 27 1 0
37 32 1 0
24 38 1 0
38 20 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 507.59Molecular Weight (Monoisotopic): 507.2270AlogP: 4.35#Rotatable Bonds: 5Polar Surface Area: 112.90Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.18CX Basic pKa: 4.37CX LogP: 2.87CX LogD: 2.87Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.33Np Likeness Score: -0.80
References 1. (2016) Indazole derivatives useful as ERK inhibitors,