The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9187477, 14 ID: ALA4114379
PubChem CID: 121596278
Max Phase: Preclinical
Molecular Formula: C27H32ClN5O6
Molecular Weight: 558.04
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)NC(=O)OC1CCN(c2ccc(-c3nc4[nH]c(O[C@@H]5COC6C5OC[C@H]6O)nc4cc3Cl)cc2)CC1
Standard InChI: InChI=1S/C27H32ClN5O6/c1-14(2)29-27(35)38-17-7-9-33(10-8-17)16-5-3-15(4-6-16)22-18(28)11-19-25(31-22)32-26(30-19)39-21-13-37-23-20(34)12-36-24(21)23/h3-6,11,14,17,20-21,23-24,34H,7-10,12-13H2,1-2H3,(H,29,35)(H,30,31,32)/t20-,21-,23?,24?/m1/s1
Standard InChI Key: VHWHYFCENXKFDN-WXYTXABISA-N
Molfile:
RDKit 2D
39 44 0 0 1 0 0 0 0 0999 V2000
12.7003 -10.3867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6643 -9.7813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6221 -10.3762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6712 -8.2805 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3753 -7.5233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3332 -8.1182 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3822 -6.0225 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0864 -5.2653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0912 -3.7653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7945 -3.0112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4930 -3.7570 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4884 -5.2570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7850 -6.0111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1945 -3.0045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1969 -1.5045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8991 -0.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5965 -3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8943 -3.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3115 2.9665 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8032 3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5551 4.4192 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.0559 4.4171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9115 3.2005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3397 3.6590 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.3449 5.1590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2302 6.3675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.4302 6.3630 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.3528 7.5841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9246 7.1255 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.9200 5.6275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4133 1.7530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -2.7000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
4 5 1 0
5 6 2 0
5 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 8 1 0
11 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
17 20 1 0
20 21 2 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
26 25 1 6
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 6
30 32 1 0
32 33 1 0
33 34 1 0
34 26 1 0
34 29 1 0
24 35 2 0
35 36 1 0
36 22 2 0
36 37 1 0
37 38 2 0
38 20 1 0
38 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 558.04Molecular Weight (Monoisotopic): 557.2041AlogP: 3.29#Rotatable Bonds: 6Polar Surface Area: 131.06Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.06CX Basic pKa: 4.06CX LogP: 3.22CX LogD: 3.21Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.42Np Likeness Score: -0.47
References 1. (2015) Azabenzimidazole derivatives,