US9187477, 8

ID: ALA4114389

Max Phase: Preclinical

Molecular Formula: C28H33ClN4O6

Molecular Weight: 557.05

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)NC(=O)O[C@H]1CC[C@H](c2ccc(-c3nc4[nH]c(O[C@@H]5COC6C5OC[C@H]6O)nc4cc3Cl)cc2)CC1

Standard InChI:  InChI=1S/C28H33ClN4O6/c1-14(2)30-28(35)38-18-9-7-16(8-10-18)15-3-5-17(6-4-15)23-19(29)11-20-26(32-23)33-27(31-20)39-22-13-37-24-21(34)12-36-25(22)24/h3-6,11,14,16,18,21-22,24-25,34H,7-10,12-13H2,1-2H3,(H,30,35)(H,31,32,33)/t16-,18-,21-,22-,24?,25?/m1/s1

Standard InChI Key:  WOBBBCGQZGWXDO-LQWLQZETSA-N

Molfile:  

     RDKit          2D

 39 44  0  0  1  0  0  0  0  0999 V2000
   12.7003  -10.3867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6643   -9.7813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6221  -10.3762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6712   -8.2805    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.3753   -7.5233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3332   -8.1182    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3822   -6.0225    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0864   -5.2653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0912   -3.7653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7945   -3.0112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4930   -3.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4884   -5.2570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7850   -6.0111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1945   -3.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1969   -1.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8991   -0.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5987   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5965   -3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8943   -3.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3115    2.9665    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8032    3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5551    4.4192    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0559    4.4171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9115    3.2005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3397    3.6590    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3449    5.1590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2302    6.3675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.4302    6.3630    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3528    7.5841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9246    7.1255    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9200    5.6275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4133    1.7530    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.7000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  4  5  1  0
  5  6  2  0
  5  7  1  0
  8  7  1  1
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13  8  1  0
 11 14  1  6
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 17 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 26 25  1  6
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  6
 30 32  1  0
 32 33  1  0
 33 34  1  0
 34 26  1  0
 34 29  1  0
 24 35  2  0
 35 36  1  0
 36 22  2  0
 36 37  1  0
 37 38  2  0
 38 20  1  0
 38 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4114389

    ---

Associated Targets(Human)

PRKAA1 Tclin AMP-activated protein kinase, alpha-1 subunit (2493 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 557.05Molecular Weight (Monoisotopic): 556.2089AlogP: 4.35#Rotatable Bonds: 6
Polar Surface Area: 127.82Molecular Species: NEUTRALHBA: 8HBD: 3
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.06CX Basic pKa: 0.22CX LogP: 4.52CX LogD: 4.51
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.41Np Likeness Score: -0.12

References

1.  (2015)  Azabenzimidazole derivatives, 

Source

Source(1):