US9174974, Comparator 3

ID: ALA4114547

PubChem CID: 24871962

Max Phase: Preclinical

Molecular Formula: C31H33N5O5S

Molecular Weight: 587.70

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCS(=O)(=O)c1ccc2cc1CNC(=O)[C@H](Nc1ccc3c(N)nccc3c1)c1cc(C)c(c(C)c1)CCOC(=O)N2

Standard InChI:  InChI=1S/C31H33N5O5S/c1-4-42(39,40)27-8-6-24-16-22(27)17-34-30(37)28(35-23-5-7-26-20(15-23)9-11-33-29(26)32)21-13-18(2)25(19(3)14-21)10-12-41-31(38)36-24/h5-9,11,13-16,28,35H,4,10,12,17H2,1-3H3,(H2,32,33)(H,34,37)(H,36,38)/t28-/m1/s1

Standard InChI Key:  MYGIQCOFJNZEGJ-MUUNZHRXSA-N

Molfile:  

     RDKit          2D

 42 46  0  0  1  0  0  0  0  0999 V2000
   -2.8309   -3.2617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7916   -2.6617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7906   -1.1609    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8297   -0.5605    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8302   -1.7604    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4900   -0.4100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4900    0.9900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7200    1.6800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9300    0.9900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5800    2.1000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3200    1.0300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3052   -0.1699    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1600    2.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2100    0.9900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2100   -0.4100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0000   -1.1100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0000   -2.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0403   -3.0982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7800   -3.2100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5700   -2.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5700   -1.1100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7800   -0.4100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7779    0.7900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3400   -3.2100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3224   -4.7115    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6127   -5.4781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5973   -6.9780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8885   -7.7414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1952   -7.0049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4865   -7.7683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4741   -8.9682    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.7932   -7.0317    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8087   -5.5318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5175   -4.7684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2108   -5.5050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9195   -4.7416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1500   -2.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1565   -1.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9300   -3.2100    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7200   -2.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7200   -1.1100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9300   -0.4100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  3  5  2  0
  3  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 17 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 16  1  0
 22 23  1  0
 20 24  1  0
 24 25  1  1
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  1  0
 30 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 29  1  0
 35 36  2  0
 36 26  1  0
 24 37  1  0
 37 38  2  0
 37 39  1  0
 39 40  1  0
 40 41  1  0
 41  6  1  0
 41 42  2  0
 42  9  1  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(Human)

F7 Tchem Coagulation factor VII (948 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 587.70Molecular Weight (Monoisotopic): 587.2202AlogP: 4.80#Rotatable Bonds: 4
Polar Surface Area: 152.51Molecular Species: BASEHBA: 8HBD: 4
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.15CX Basic pKa: 9.17CX LogP: 3.81CX LogD: 2.50
Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.27Np Likeness Score: -0.31

References

1.  (2015)  Macrocyclic factor VIIa inhibitors, 

Source

Source(1):