The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9351965, 90 ID: ALA4114558
PubChem CID: 57411382
Max Phase: Preclinical
Molecular Formula: C28H28N6O2
Molecular Weight: 480.57
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(-c2n[nH]c3ccc(C(=O)N[C@@H]4CCC[C@](O)(Cn5cc6ccccc6n5)C4)cc23)ccn1
Standard InChI: InChI=1S/C28H28N6O2/c1-18-13-19(10-12-29-18)26-23-14-20(8-9-25(23)31-32-26)27(35)30-22-6-4-11-28(36,15-22)17-34-16-21-5-2-3-7-24(21)33-34/h2-3,5,7-10,12-14,16,22,36H,4,6,11,15,17H2,1H3,(H,30,35)(H,31,32)/t22-,28-/m1/s1
Standard InChI Key: IBOBUOSOXNUHIM-SKCUWOTOSA-N
Molfile:
RDKit 2D
36 41 0 0 1 0 0 0 0 0999 V2000
-1.1395 -7.7360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4233 -6.5700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3384 -5.5341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6928 -4.0817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1327 -3.6551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2175 -4.6910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8628 -6.1485 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3114 -2.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 -3.1233 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -1.7530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6024 2.6977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8990 0.7455 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.2003 1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4994 0.7432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7985 1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7985 2.9932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4995 3.7432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4459 4.3176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.7994 4.4516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0995 3.7017 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-10.4615 4.2962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.4427 3.1627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9424 3.1337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.6672 1.8204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.8922 0.5361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.3925 0.5651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.6677 1.8784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.2075 2.2182 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.2004 2.9933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
4 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 8 1 0
16 11 1 0
14 17 1 0
17 18 2 0
17 19 1 0
20 19 1 6
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 1
24 26 1 0
26 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 29 1 0
34 35 2 0
35 27 1 0
24 36 1 0
36 20 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 480.57Molecular Weight (Monoisotopic): 480.2274AlogP: 4.39#Rotatable Bonds: 5Polar Surface Area: 108.72Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.17CX Basic pKa: 4.37CX LogP: 3.19CX LogD: 3.19Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.35Np Likeness Score: -0.81
References 1. (2016) Indazole derivatives useful as ERK inhibitors,