US8742113, 126

ID: ALA4114693

PubChem CID: 86766016

Max Phase: Preclinical

Molecular Formula: C24H24N4O5

Molecular Weight: 448.48

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)C1C(=O)/C(=C/c2c[nH]c3ncccc23)O/C1=N\c1ccc(NCCO)cc1C

Standard InChI:  InChI=1S/C24H24N4O5/c1-3-32-24(31)20-21(30)19(12-15-13-27-22-17(15)5-4-8-26-22)33-23(20)28-18-7-6-16(11-14(18)2)25-9-10-29/h4-8,11-13,20,25,29H,3,9-10H2,1-2H3,(H,26,27)/b19-12-,28-23-

Standard InChI Key:  HIYZTWSPZHDMJU-URYGXRHHSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   -3.7863  -11.3347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6130  -11.0830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1509   -9.6551    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6835   -9.3403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1208  -10.2309    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2222   -7.9149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2028   -7.4466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4196   -8.3208    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7878   -7.7038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9346   -6.2109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3007   -5.5916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5202   -6.4650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8884   -5.8481    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1073   -6.7238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4755   -6.1069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4500   -6.8070    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3735   -7.9578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0074   -8.5772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8900   -9.7715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1979   -5.9466    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2234   -5.5086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6890   -4.0818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3114   -2.9665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8032   -3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4133   -1.7530    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1079   -6.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3079   -6.7011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  4  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 12 17  1  0
 17 18  2  0
 18  9  1  0
 18 19  1  0
  7 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 23  1  0
 31 26  1  0
 21 32  1  0
 32  6  1  0
 32 33  2  0
M  END

Associated Targets(Human)

CDC7 Tchem Cell division cycle 7-related protein kinase (1385 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 448.48Molecular Weight (Monoisotopic): 448.1747AlogP: 3.13#Rotatable Bonds: 7
Polar Surface Area: 125.90Molecular Species: NEUTRALHBA: 8HBD: 3
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 9.02CX Basic pKa: 3.91CX LogP: 2.88CX LogD: 2.87
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.29Np Likeness Score: -0.86

References

1.  (2014)  Furanone derivative, 

Source

Source(1):