The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8552037, 84 ID: ALA4114715
PubChem CID: 57781262
Max Phase: Preclinical
Molecular Formula: C24H26N2O2
Molecular Weight: 374.48
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)NC/C=C1\CCc2ccc3nc(CCCCc4ccccc4)oc3c21
Standard InChI: InChI=1S/C24H26N2O2/c1-17(27)25-16-15-20-12-11-19-13-14-21-24(23(19)20)28-22(26-21)10-6-5-9-18-7-3-2-4-8-18/h2-4,7-8,13-15H,5-6,9-12,16H2,1H3,(H,25,27)/b20-15+
Standard InChI Key: HEWLIENXMUSPDG-HMMYKYKNSA-N
Molfile:
RDKit 2D
28 31 0 0 0 0 0 0 0 0999 V2000
0.4141 -8.3003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7600 -8.0526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5613 -8.9459 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2256 -6.6258 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.2234 -5.5086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6890 -4.0818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3114 -2.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -1.7530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 1.2135 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6065 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1047 -0.0031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8532 -1.3040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.3541 -1.3071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.1026 -2.6079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.6034 -2.6111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3534 -3.9101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.8534 -3.9102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.6035 -2.6112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.8536 -1.3121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3536 -1.3120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 -1.2135 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
15 26 1 0
26 27 1 0
27 13 1 0
27 28 2 0
28 7 1 0
28 10 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 374.48Molecular Weight (Monoisotopic): 374.1994AlogP: 4.86#Rotatable Bonds: 7Polar Surface Area: 55.13Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 1.26CX LogP: 4.51CX LogD: 4.51Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.60Np Likeness Score: -0.18
References 1. (2013) Tricyclic compound and pharmaceutical use thereof,