US8552037, 84

ID: ALA4114715

PubChem CID: 57781262

Max Phase: Preclinical

Molecular Formula: C24H26N2O2

Molecular Weight: 374.48

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)NC/C=C1\CCc2ccc3nc(CCCCc4ccccc4)oc3c21

Standard InChI:  InChI=1S/C24H26N2O2/c1-17(27)25-16-15-20-12-11-19-13-14-21-24(23(19)20)28-22(26-21)10-6-5-9-18-7-3-2-4-8-18/h2-4,7-8,13-15H,5-6,9-12,16H2,1H3,(H,25,27)/b20-15+

Standard InChI Key:  HEWLIENXMUSPDG-HMMYKYKNSA-N

Molfile:  

     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
    0.4141   -8.3003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7600   -8.0526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5613   -8.9459    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2256   -6.6258    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2234   -5.5086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6890   -4.0818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3114   -2.9665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8032   -3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4133   -1.7530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7248    1.2135    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6065    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1047   -0.0031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8532   -1.3040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3541   -1.3071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.1026   -2.6079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.6034   -2.6111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3534   -3.9101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.8534   -3.9102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.6035   -2.6112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.8536   -1.3121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3536   -1.3120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7248   -1.2135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 15 26  1  0
 26 27  1  0
 27 13  1  0
 27 28  2  0
 28  7  1  0
 28 10  1  0
M  END

Associated Targets(Human)

MTNR1B Tclin Melatonin receptor 1B (2168 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MTNR1A Tclin Melatonin receptor 1A (2519 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 374.48Molecular Weight (Monoisotopic): 374.1994AlogP: 4.86#Rotatable Bonds: 7
Polar Surface Area: 55.13Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.26CX LogP: 4.51CX LogD: 4.51
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.60Np Likeness Score: -0.18

References

1.  (2013)  Tricyclic compound and pharmaceutical use thereof, 

Source

Source(1):