US8742113, 233

ID: ALA4114785

PubChem CID: 86766022

Max Phase: Preclinical

Molecular Formula: C19H14FN3O2

Molecular Weight: 335.34

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(F)ccc1/N=C1/CC(=O)/C(=C/c2c[nH]c3ncccc23)O1

Standard InChI:  InChI=1S/C19H14FN3O2/c1-11-7-13(20)4-5-15(11)23-18-9-16(24)17(25-18)8-12-10-22-19-14(12)3-2-6-21-19/h2-8,10H,9H2,1H3,(H,21,22)/b17-8-,23-18-

Standard InChI Key:  CIUXINGXNDQWMS-QJPGSKMASA-N

Molfile:  

     RDKit          2D

 25 28  0  0  0  0  0  0  0  0999 V2000
    4.8900   -9.7715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0074   -8.5772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3735   -7.9578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5202   -6.4650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6131   -5.9695    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.3007   -5.5916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9346   -6.2110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7878   -7.7038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4196   -8.3208    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2028   -7.4466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2222   -7.9149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1079   -6.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3079   -6.7011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2234   -5.5086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6890   -4.0818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3114   -2.9665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8032   -3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4133   -1.7530    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1979   -5.9466    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  4  6  2  0
  6  7  1  0
  7  8  2  0
  8  2  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 16  1  0
 24 19  1  0
 14 25  1  0
 25 10  1  0
M  END

Associated Targets(Human)

CDC7 Tchem Cell division cycle 7-related protein kinase (1385 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 335.34Molecular Weight (Monoisotopic): 335.1070AlogP: 4.07#Rotatable Bonds: 2
Polar Surface Area: 67.34Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 8.38CX Basic pKa: 3.25CX LogP: 4.01CX LogD: 3.96
Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.72Np Likeness Score: -1.11

References

1.  (2014)  Furanone derivative, 

Source

Source(1):