The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9242981, 76 ID: ALA4114970
PubChem CID: 89654496
Max Phase: Preclinical
Molecular Formula: C28H31N7O2
Molecular Weight: 497.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1onc(-c2ccccc2)c1CN1CCC[C@@H](NC(=O)N2CCc3[nH]nc(-c4ccncc4)c3C2)C1
Standard InChI: InChI=1S/C28H31N7O2/c1-19-23(27(33-37-19)20-6-3-2-4-7-20)17-34-14-5-8-22(16-34)30-28(36)35-15-11-25-24(18-35)26(32-31-25)21-9-12-29-13-10-21/h2-4,6-7,9-10,12-13,22H,5,8,11,14-18H2,1H3,(H,30,36)(H,31,32)/t22-/m1/s1
Standard InChI Key: WDSSEDSIAVGFIO-JOCHJYFZSA-N
Molfile:
RDKit 2D
37 42 0 0 1 0 0 0 0 0999 V2000
2.3008 -6.4546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5392 -7.6306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5316 -8.7418 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2771 -10.0435 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7454 -9.7368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8884 -8.2564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1893 -7.5079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1924 -6.0070 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4915 -5.2571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4915 -3.7571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1925 -3.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8934 -5.2570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6375 -0.9049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 1.2135 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6065 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 -1.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1884 -2.6409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6234 -3.0602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9781 -4.5176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8933 -5.5536 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4537 -5.1320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0990 -3.6745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8631 -10.7382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3158 -10.3862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3500 -11.4727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9261 -12.9116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4681 -13.2639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4339 -12.1774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
6 2 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 8 1 0
12 14 1 6
14 15 1 0
15 16 2 0
15 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 20 2 0
24 25 1 0
25 17 1 0
23 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
5 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 497.60Molecular Weight (Monoisotopic): 497.2539AlogP: 4.17#Rotatable Bonds: 5Polar Surface Area: 103.18Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.93CX Basic pKa: 7.72CX LogP: 2.69CX LogD: 2.20Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.43Np Likeness Score: -1.84
References 1. (2016) Fused pyrazole derivatives as novel ERK inhibitors,