The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9320722, 19 ID: ALA4115065
PubChem CID: 17560769
Max Phase: Preclinical
Molecular Formula: C22H29N5O5S
Molecular Weight: 475.57
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)NS(=O)(=O)c1ccc(NC2CCN(CC(=O)Nc3ccccc3)CC2)c([N+](=O)[O-])c1
Standard InChI: InChI=1S/C22H29N5O5S/c1-16(2)25-33(31,32)19-8-9-20(21(14-19)27(29)30)23-18-10-12-26(13-11-18)15-22(28)24-17-6-4-3-5-7-17/h3-9,14,16,18,23,25H,10-13,15H2,1-2H3,(H,24,28)
Standard InChI Key: HZIAVAFBOJTXSF-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
6.2384 -0.9019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1988 -1.5012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1984 -2.7012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7508 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5988 -1.5004 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.6377 -2.1009 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5984 -2.7004 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5973 1.5031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5951 3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8916 3.7585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8864 5.2585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5847 6.0040 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5765 7.5048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2731 8.2489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2370 7.6435 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2648 9.7497 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0386 10.4937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0490 11.9937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3532 12.7347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6471 11.9758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6367 10.4758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3325 9.7348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2883 5.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2935 3.7495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5972 -1.5031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5955 -2.7031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6375 -0.9049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
4 5 1 0
5 6 2 0
5 7 2 0
5 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
18 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
16 27 1 0
27 28 1 0
28 13 1 0
11 29 1 0
29 30 2 0
30 8 1 0
29 31 1 0
31 32 2 0
31 33 1 0
M CHG 2 31 1 33 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 475.57Molecular Weight (Monoisotopic): 475.1889AlogP: 2.80#Rotatable Bonds: 9Polar Surface Area: 133.68Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.19CX Basic pKa: 6.70CX LogP: 2.58CX LogD: 2.50Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.37Np Likeness Score: -2.24
References 1. (2016) Regulators of aldehyde dehydrogenase ALDH3A1 and related therapeutic methods,