The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9409931, 6 ID: ALA4115540
PubChem CID: 122463819
Max Phase: Preclinical
Molecular Formula: C28H40O5
Molecular Weight: 456.62
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC1=C[C@]23C(=O)[C@@H](C=C(CO)C[C@]2(O)[C@H]1OC(=O)C1(C)CCCCC1)[C@H]1[C@@H](C[C@H]3C)C1(C)C
Standard InChI: InChI=1S/C28H40O5/c1-16-13-27-17(2)11-20-21(25(20,3)4)19(22(27)30)12-18(15-29)14-28(27,32)23(16)33-24(31)26(5)9-7-6-8-10-26/h12-13,17,19-21,23,29,32H,6-11,14-15H2,1-5H3/t17-,19+,20-,21+,23+,27+,28+/m1/s1
Standard InChI Key: XSYPVMLJRHZFFX-DTPHZIEISA-N
Molfile:
RDKit 2D
33 37 0 0 1 0 0 0 0 0999 V2000
-2.0255 2.9094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0100 2.2700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8100 3.2300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9800 2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5900 1.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0400 -0.2800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0600 -1.9400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9600 -2.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4116 -4.0389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6009 -4.9236 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4600 -2.5700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6200 -1.2200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1880 -2.2771 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2100 -1.0200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1832 -2.1598 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6831 -3.5749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5033 -3.7940 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.6579 -4.7161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2578 -5.8474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1173 -3.3096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5922 -3.0360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5666 -4.1764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.0662 -5.5904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5913 -5.8641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6600 0.4600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3400 1.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0800 0.4500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5900 0.7600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8511 1.9313 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.7854 0.8765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3700 2.4300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4171 3.6291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3985 1.8118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 6
2 3 1 0
4 3 1 1
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
8 11 1 0
11 12 1 0
12 13 1 1
12 14 1 0
14 15 1 1
15 16 1 0
16 17 2 0
16 18 1 0
18 19 1 0
18 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 18 1 0
14 25 1 0
25 26 2 0
27 26 1 6
27 2 1 0
27 12 1 0
27 28 1 0
6 28 1 6
28 29 2 0
25 30 1 0
5 31 1 1
31 4 1 0
31 32 1 0
31 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 456.62Molecular Weight (Monoisotopic): 456.2876AlogP: 4.37#Rotatable Bonds: 3Polar Surface Area: 83.83Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.02CX Basic pKa: ┄CX LogP: 4.32CX LogD: 4.32Aromatic Rings: ┄Heavy Atoms: 33QED Weighted: 0.49Np Likeness Score: 2.22
References 1. (2016) 3-O-acyl-ingenol analogues,