{9-[3-(2-methoxy-phenoxy)-benzyl]-3,9-diaza-spiro[5.5]undec-3-yl}-(1-oxy-pyridin-2-yl)-methanone

ID: ALA411651

PubChem CID: 11842667

Max Phase: Preclinical

Molecular Formula: C29H33N3O4

Molecular Weight: 487.60

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccccc1Oc1cccc(CN2CCC3(CC2)CCN(C(=O)c2cccc[n+]2[O-])CC3)c1

Standard InChI:  InChI=1S/C29H33N3O4/c1-35-26-10-2-3-11-27(26)36-24-8-6-7-23(21-24)22-30-17-12-29(13-18-30)14-19-31(20-15-29)28(33)25-9-4-5-16-32(25)34/h2-11,16,21H,12-15,17-20,22H2,1H3

Standard InChI Key:  SELXSHINISBLTM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
    1.6460  -21.4979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3585  -21.9105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0682  -21.5019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0714  -20.6791    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3588  -20.2666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6431  -20.6768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1873  -24.8161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4720  -25.2258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2419  -24.8106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2361  -23.9812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4796  -23.5751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4870  -22.7501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2237  -22.3312    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9404  -22.7423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6492  -22.3270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9280  -21.0932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2130  -21.5103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7871  -20.2685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5005  -20.6828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7892  -19.4434    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4955  -21.5073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2082  -21.9217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9248  -21.5109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9243  -20.6815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2110  -20.2710    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9012  -25.2297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6133  -24.8294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0435  -24.0024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0447  -24.8298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3297  -25.2427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6162  -23.9987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3315  -23.5895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9031  -23.5834    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1870  -23.9933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9063  -22.7583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2098  -19.4459    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1 16  1  0
 16 17  1  0
  1  6  1  0
  4 18  1  0
  8  9  2  0
 18 19  1  0
  2  3  1  0
 18 20  2  0
  9 10  1  0
 19 21  2  0
  3  4  1  0
 21 22  1  0
 10 11  2  0
 22 23  2  0
 11 34  1  0
 23 24  1  0
  4  5  1  0
 24 25  2  0
 25 19  1  0
 11 12  1  0
  7 26  1  0
  5  6  1  0
 26 27  1  0
 12 13  1  0
 13 14  1  0
 28 29  2  0
 29 30  1  0
 30 27  2  0
 34  7  2  0
 27 31  1  0
  1  2  1  0
 31 32  2  0
 32 28  1  0
  7  8  1  0
 31 33  1  0
 13 17  1  0
 14 15  1  0
 33 35  1  0
 15  1  1  0
 25 36  1  0
M  CHG  2  25   1  36  -1
M  END

Associated Targets(Human)

CCR8 Tchem C-C chemokine receptor type 8 (339 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
KCNH2 Tclin HERG (29587 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 487.60Molecular Weight (Monoisotopic): 487.2471AlogP: 4.64#Rotatable Bonds: 6
Polar Surface Area: 68.95Molecular Species: BASEHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.89CX LogP: 2.98CX LogD: 1.48
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.37Np Likeness Score: -0.95

References

1. Shamovsky I, Connolly S, David L, Ivanova S, Nordén B, Springthorpe B, Urbahns K..  (2008)  Overcoming undesirable HERG potency of chemokine receptor antagonists using baseline lipophilicity relationships.,  51  (5): [PMID:18257512] [10.1021/jm070543k]

Source