2-(4,5-di(1,3,2-dithiarsolan-2-yl)-2,7-difluoro-6-hydroxy-3-oxo-3H-xanthen-9-yl)benzoic acid

ID: ALA4126115

PubChem CID: 57655010

Max Phase: Preclinical

Molecular Formula: C24H16As2F2O5S4

Molecular Weight: 700.50

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  O=C(O)c1ccccc1-c1c2cc(F)c(=O)c([As]3SCCS3)c-2oc2c([As]3SCCS3)c(O)c(F)cc12

Standard InChI:  InChI=1S/C24H16As2F2O5S4/c27-15-9-13-17(11-3-1-2-4-12(11)24(31)32)14-10-16(28)21(30)19(26-36-7-8-37-26)23(14)33-22(13)18(20(15)29)25-34-5-6-35-25/h1-4,9-10,29H,5-8H2,(H,31,32)

Standard InChI Key:  VWHJQRQKBSHDDI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 42  0  0  0  0  0  0  0  0999 V2000
   12.0123  -13.6731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0112  -14.5010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7271  -14.9162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4445  -14.5005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4416  -13.6695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7253  -13.2621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7252  -12.4400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7259  -10.7899    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.4407  -11.2024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4408  -12.0264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1511  -12.4382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8659  -12.0263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8659  -11.2022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1510  -10.7901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0086  -12.0297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0124  -11.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3001  -10.7920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5874  -11.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5875  -12.0286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2964  -12.4412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5817  -10.7922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.1498   -9.9646    0.0000 As  0  0  0  0  0  3  0  0  0  0  0  0
   11.3030   -9.9664    0.0000 As  0  0  0  0  0  3  0  0  0  0  0  0
    9.8727  -10.7880    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9760   -9.4829    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   11.7250   -8.6967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8993   -8.6938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6429   -9.4782    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   14.8170   -9.4827    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   14.5579   -8.6977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7323   -8.6989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4798   -9.4846    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   14.1556  -13.2561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8726  -13.6642    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8638  -12.8393    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8755  -12.4381    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   15.5802  -12.4391    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7 10  2  0
  7 15  1  0
  9  8  1  0
  8 16  1  0
  6  7  1  0
  9 10  1  0
  9 14  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 13 21  2  0
 14 22  1  0
 17 23  1  0
 18 24  1  0
 23 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 23  1  0
 22 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 22  1  0
  5 33  1  0
 33 34  1  0
 33 35  2  0
 19 36  1  0
 12 37  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4126115

   2-[4,5-Bis(1,3,2-dithiarsolan-2-yl)-2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl]benzoic acid

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 700.50

Molecular Weight (Monoisotopic): 699.8281

AlogP: ┄

#Rotatable Bonds: ┄

Polar Surface Area: ┄

Molecular Species: ┄

HBA: ┄

HBD: ┄

#RO5 Violations: ┄

HBA (Lipinski): ┄

HBD (Lipinski): ┄

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: ┄

CX LogD: ┄

Aromatic Rings: ┄

Heavy Atoms: ┄

QED Weighted: ┄

Np Likeness Score: ┄

References

1. Korntner S, Pomorski A, Krężel A, Bishop AC..  (2018)  Optimized allosteric inhibition of engineered protein tyrosine phosphatases with an expanded palette of biarsenical small molecules.,  26  (9): [PMID:29673715] [10.1016/j.bmc.2018.04.026]

Source

Source(1):

• Scientific Literature