2-(4,5-di(1,3,2-dithiarsolan-2-yl)-2,7-diethyl-6-hydroxy-3-oxo-3H-xanthen-9-yl)benzoic acid

ID: ALA4126271

PubChem CID: 145963572

Max Phase: Preclinical

Molecular Formula: C28H26As2O5S4

Molecular Weight: 720.62

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCc1cc2c(-c3ccccc3C(=O)O)c3cc(CC)c(=O)c([As]4SCCS4)c-3oc2c([As]2SCCS2)c1O

Standard InChI:  InChI=1S/C28H26As2O5S4/c1-3-15-13-19-21(17-7-5-6-8-18(17)28(33)34)20-14-16(4-2)25(32)23(30-38-11-12-39-30)27(20)35-26(19)22(24(15)31)29-36-9-10-37-29/h5-8,13-14,31H,3-4,9-12H2,1-2H3,(H,33,34)

Standard InChI Key:  DSAFWHCMNHOLJT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 39 44  0  0  0  0  0  0  0  0999 V2000
   19.4718  -13.6528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4706  -14.4807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1865  -14.8959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9039  -14.4803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9011  -13.6492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1847  -13.2418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1846  -12.4197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1853  -10.7695    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.9002  -11.1819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9002  -12.0061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6106  -12.4179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3254  -12.0060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3253  -11.1818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6105  -10.7697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4680  -12.0093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4719  -11.1837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7594  -10.7715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0468  -11.1795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0470  -12.0082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7558  -12.4209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0412  -10.7718    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.6093   -9.9441    0.0000 As  0  0  0  0  0  3  0  0  0  0  0  0
   18.7624   -9.9460    0.0000 As  0  0  0  0  0  3  0  0  0  0  0  0
   17.3320  -10.7676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.4354   -9.4625    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   19.1844   -8.6762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3588   -8.6732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1023   -9.4578    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   22.2766   -9.4622    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   22.0175   -8.6773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1918   -8.6785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9392   -9.4642    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   21.6151  -13.2358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3321  -13.6438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.3232  -12.8189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.3348  -12.4177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6242  -12.0058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0398  -12.4187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7544  -12.0065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7 10  2  0
  7 15  1  0
  9  8  1  0
  8 16  1  0
  6  7  1  0
  9 10  1  0
  9 14  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 13 21  2  0
 14 22  1  0
 17 23  1  0
 18 24  1  0
 23 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 23  1  0
 22 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 22  1  0
  5 33  1  0
 33 34  1  0
 33 35  2  0
 19 36  1  0
 36 37  1  0
 12 38  1  0
 38 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4126271

    ---

Associated Targets(Human)

PTPN7 Tchem Protein-tyrosine phosphatase LC-PTP (886 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 720.62Molecular Weight (Monoisotopic): 719.9095AlogP: #Rotatable Bonds:
Polar Surface Area: Molecular Species: HBA: HBD:
#RO5 Violations: HBA (Lipinski): HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: CX LogD:
Aromatic Rings: Heavy Atoms: QED Weighted: Np Likeness Score:

References

1. Korntner S, Pomorski A, Krężel A, Bishop AC..  (2018)  Optimized allosteric inhibition of engineered protein tyrosine phosphatases with an expanded palette of biarsenical small molecules.,  26  (9): [PMID:29673715] [10.1016/j.bmc.2018.04.026]

Source