The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R/S)-4-(2-hydroxy-3-(4-(pyridin-2-yl)piperazin-1-yl)propoxy)-9H-xanthen-9-one hydrochloride ID: ALA4126588
PubChem CID: 145961907
Max Phase: Preclinical
Molecular Formula: C25H26ClN3O4
Molecular Weight: 431.49
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cl.O=c1c2ccccc2oc2c(OCC(O)CN3CCN(c4ccccn4)CC3)cccc12
Standard InChI: InChI=1S/C25H25N3O4.ClH/c29-18(16-27-12-14-28(15-13-27)23-10-3-4-11-26-23)17-31-22-9-5-7-20-24(30)19-6-1-2-8-21(19)32-25(20)22;/h1-11,18,29H,12-17H2;1H
Standard InChI Key: ROJORJNQEWJGRC-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
11.8576 -13.7669 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
9.3579 -13.4748 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0641 -13.8808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0635 -14.7036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7738 -15.1137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7731 -15.9324 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4834 -16.3425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4828 -17.1612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7759 -17.5698 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0697 -17.1638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0704 -16.3410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7752 -18.3926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4856 -18.8027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4849 -19.6214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7739 -20.0300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0677 -19.6240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0684 -18.8012 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3566 -15.1122 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9458 -11.0202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6509 -11.4303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3571 -11.0233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0663 -11.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0694 -12.2464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3590 -12.6576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6539 -12.2475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9478 -12.6546 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2385 -12.2486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5323 -12.6557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8231 -12.2456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8201 -11.4284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5304 -11.0213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2355 -11.4314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9469 -10.2031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3 4 1 0
4 5 1 0
2 3 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
6 11 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
12 17 2 0
9 12 1 0
5 6 1 0
4 18 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
20 25 2 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
27 32 2 0
19 32 1 0
19 33 2 0
24 2 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 431.49Molecular Weight (Monoisotopic): 431.1845AlogP: 2.90#Rotatable Bonds: 6Polar Surface Area: 79.04Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.44CX LogP: 3.31CX LogD: 3.26Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.47Np Likeness Score: -1.02
References 1. Kubacka M, Szkaradek N, Mogilski S, Pańczyk K, Siwek A, Gryboś A, Filipek B, Żmudzki P, Marona H, Waszkielewicz AM.. (2018) Design, synthesis and cardiovascular evaluation of some aminoisopropanoloxy derivatives of xanthone., 26 (13): [PMID:29706529 ] [10.1016/j.bmc.2018.04.038 ]