2-(2,7-dichloro-4,5-di(1,3,2-dithiarsolan-2-yl)-6-hydroxy-3-oxo-3H-xanthen-9-yl)benzoic acid

ID: ALA4127502

PubChem CID: 145963015

Max Phase: Preclinical

Molecular Formula: C24H16As2Cl2O5S4

Molecular Weight: 733.40

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)c1ccccc1-c1c2cc(Cl)c(=O)c([As]3SCCS3)c-2oc2c([As]3SCCS3)c(O)c(Cl)cc12

Standard InChI:  InChI=1S/C24H16As2Cl2O5S4/c27-15-9-13-17(11-3-1-2-4-12(11)24(31)32)14-10-16(28)21(30)19(26-36-7-8-37-26)23(14)33-22(13)18(20(15)29)25-34-5-6-35-25/h1-4,9-10,29H,5-8H2,(H,31,32)

Standard InChI Key:  BNPWPVJEHDKQKH-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 42  0  0  0  0  0  0  0  0999 V2000
    3.9229  -14.0631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9218  -14.8909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6377  -15.3061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3551  -14.8905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3522  -14.0595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6359  -13.6521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6358  -12.8300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6365  -11.1799    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3513  -11.5923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3514  -12.4164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0617  -12.8282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7765  -12.4163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7765  -11.5922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0616  -11.1800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9192  -12.4196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9230  -11.5941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2107  -11.1819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4981  -11.5899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4982  -12.4185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2070  -12.8312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4923  -11.1822    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0604  -10.3545    0.0000 As  0  0  0  0  0  3  0  0  0  0  0  0
    3.2136  -10.3564    0.0000 As  0  0  0  0  0  3  0  0  0  0  0  0
    1.7833  -11.1780    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8866   -9.8729    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.6356   -9.0866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8099   -9.0837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5535   -9.8682    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.7276   -9.8726    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.4685   -9.0877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6429   -9.0889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3904   -9.8746    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.0662  -13.6461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7832  -14.0540    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7744  -13.2292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7861  -12.8280    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    7.4908  -12.8291    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7 10  2  0
  7 15  1  0
  9  8  1  0
  8 16  1  0
  6  7  1  0
  9 10  1  0
  9 14  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 13 21  2  0
 14 22  1  0
 17 23  1  0
 18 24  1  0
 23 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 23  1  0
 22 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 22  1  0
  5 33  1  0
 33 34  1  0
 33 35  2  0
 19 36  1  0
 12 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4127502

    ---

Associated Targets(Human)

PTPN7 Tchem Protein-tyrosine phosphatase LC-PTP (886 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 733.40Molecular Weight (Monoisotopic): 731.7690AlogP: #Rotatable Bonds:
Polar Surface Area: Molecular Species: HBA: HBD:
#RO5 Violations: HBA (Lipinski): HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: CX LogD:
Aromatic Rings: Heavy Atoms: QED Weighted: Np Likeness Score:

References

1. Korntner S, Pomorski A, Krężel A, Bishop AC..  (2018)  Optimized allosteric inhibition of engineered protein tyrosine phosphatases with an expanded palette of biarsenical small molecules.,  26  (9): [PMID:29673715] [10.1016/j.bmc.2018.04.026]

Source